- KETENE DIETHYL ACETAL
-
- $1.00
-
2019-08-30
- CAS:2678-54-8
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1kg;10kg;100kg
|
| | 1,1-diethoxyethylene Basic information |
| Product Name: | 1,1-diethoxyethylene | | Synonyms: | Diethyl ketene acetal;Ethene, 1,1-diethoxy-;1,1-Diethoxyethen;KETENE DIETHYL ACETAL STAB. WACKER &;1,1-diethoxyethylene;2-(1-ethoxypropoxy)ethen-1-one;1,1-Diethoxyethene, stabilized;135338 | | CAS: | 2678-54-8 | | MF: | C6H12O2 | | MW: | 116.16 | | EINECS: | | | Product Categories: | | | Mol File: | 2678-54-8.mol |  |
| | 1,1-diethoxyethylene Chemical Properties |
| Boiling point | 49-50 °C(lit.) | | density | 0.880 g/mL at 20 °C(lit.) | | refractive index | n20/D 1.414 | | Fp | 27 °C | | storage temp. | 2-8°C | | solubility | soluble in THF, ether, benzene; decomposes in water, ethanol. | | InChI | InChI=1S/C6H12O2/c1-4-7-6(3)8-5-2/h3-5H2,1-2H3 | | InChIKey | VTGIVYVOVVQLRL-UHFFFAOYSA-N | | SMILES | C(OCC)(OCC)=C |
| Risk Statements | 10 | | Safety Statements | 23 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 |
| | 1,1-diethoxyethylene Usage And Synthesis |
| Chemical Properties | Colorless liquid. Boiling point 76-77°C. Insoluble in water, soluble in alcohol and ether. | | Uses | 1,1-diethoxyethylene can be used as organic synthesis intermediate and pharmaceutical intermediate, mainly used in laboratory research and development process and chemical production process. | | Synthesis | 
Preparation of 1,1-diethoxyethene 610.4 g (4.0 mol) of chloroacetaldehyde diethyl acetal, 800 g (12.0 mol) of powdered technical grade potassium hydroxide, 32 g of polyethylene glycol 1000 dimethyl ether and 88 g (1.0 mol) of 2-methyl-2-butanol were heated to reflux in 1.2 l of tert.-butyl methyl ether while stirring. After six hours the reaction was stopped, the salts filtered off and the reaction mixture distilled at reduced pressure (5 kPa). 326 g (72.5% of theoretical) of 1,1-diethoxyethene (b.p. 49 C./5 kPa) were obtained. |
| | 1,1-diethoxyethylene Preparation Products And Raw materials |
|