| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Company Name: |
SIGMA-RBI |
| Tel: |
800 736 3690 (Orders) |
| Email: |
|
| Company Name: |
Medical Isotopes |
| Tel: |
1-(603) 635-1722 |
| Email: |
stohler@medicalisotopes.com |
|
| | 4-OXO-2,2,6,6-TETRAMETHYLPIPERIDINE (D17, 15N) Basic information |
| Product Name: | 4-OXO-2,2,6,6-TETRAMETHYLPIPERIDINE (D17, 15N) | | Synonyms: | 4-OXO-2,2,6,6-TETRAMETHYLPIPERIDINE (D17, 15N);4-Oxo-2,2,6,6-tetramethylpiperidine-D17: 1-15N;4-Oxo-2,2,6,6-tetramethylpiperidine-1-15N,d17 | | CAS: | 80404-11-1 | | MF: | C9D17NO | | MW: | 173.35 | | EINECS: | | | Product Categories: | Alphabetical Listings;N-O;Stable Isotopes | | Mol File: | 80404-11-1.mol |  |
| | 4-OXO-2,2,6,6-TETRAMETHYLPIPERIDINE (D17, 15N) Chemical Properties |
| Melting point | 34-38 °C(lit.) | | Fp | 73 °C | | form | solid | | InChI | 1S/C9H17NO/c1-8(2)5-7(11)6-9(3,4)10-8/h10H,5-6H2,1-4H3/i1D3,2D3,3D3,4D3,5D2,6D2,10+1/hD | | InChIKey | JWUXJYZVKZKLTJ-AWFCJHQLSA-N | | SMILES | [2H][15N]1C(C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])C(=O)C([2H])([2H])C1(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36/37 | | WGK Germany | WGK 2 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Chronic 3
Eye Dam. 1
Met. Corr. 1
Skin Corr. 1B
Skin Sens. 1A |
| | 4-OXO-2,2,6,6-TETRAMETHYLPIPERIDINE (D17, 15N) Usage And Synthesis |
| Uses | - Protein structure determination by NMR spectroscopy
- Nitrogen fixation research in agricultural science
- Isotope ratio Mass spectrometry applications
- Chemical synthesis of labeled compounds |
| | 4-OXO-2,2,6,6-TETRAMETHYLPIPERIDINE (D17, 15N) Preparation Products And Raw materials |
|