3-METHYL-2-HEXENOIC ACID manufacturers
|
| | 3-METHYL-2-HEXENOIC ACID Basic information |
| Product Name: | 3-METHYL-2-HEXENOIC ACID | | Synonyms: | 3-METHYL-2-HEXENOIC ACID;3-Methyl-2-hexenoic acid (3:1 mixture of E and Z isomers);3-METHYL-2-HEXENOIC ACID (3:1 MIXTURE OF TRANS- AND CIS- ISOMERS);(Z)-3-Methyl-2-hexenoic acid;(E)-3-methylhex-2-enoic acid;3-Methyl-2E-hexenoic acid;(2E)-3-methyl-2-Hexenoic aci;(2E)-3-methyl-2-Hexenoic acid | | CAS: | 27960-21-0 | | MF: | C7H12O2 | | MW: | 128.17 | | EINECS: | | | Product Categories: | | | Mol File: | 27960-21-0.mol |  |
| | 3-METHYL-2-HEXENOIC ACID Chemical Properties |
| Melting point | -9.25°C (estimate) | | Boiling point | 237.28°C (estimate) | | density | 0.9658 (rough estimate) | | refractive index | 1.4273 (estimate) | | solubility | Chloroform (Slightly), DMSO (Slightly) | | form | Low-Melting Solid | | pka | 5.20±0.33(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C7H12O2/c1-3-4-6(2)5-7(8)9/h5H,3-4H2,1-2H3,(H,8,9)/b6-5+ | | InChIKey | NTWSIWWJPQHFTO-AATRIKPKSA-N | | SMILES | C(O)(=O)/C=C(\C)/CCC |
| | 3-METHYL-2-HEXENOIC ACID Usage And Synthesis |
| Uses | (2E)-3-Methyl-2-hexenoic Acid, is a building block used in various chemical synthesis. It has also have a cheesy, fatty, herbal, warm odor, and is applied to cheesy, berry and fruity flavorings. | | Definition | ChEBI: (2E)-3-methylhex-2-enoic acid is a monounsaturated fatty acid that is (2E)-hexenoic acid in which the hydrogen at position 3 has been replaced by a methyl group. A malodourous component in the sweat of schizophrenics. It is a short-chain fatty acid, a monounsaturated fatty acid and an alpha,beta-unsaturated monocarboxylic acid. It is functionally related to a (2E)-hexenoic acid. It is a conjugate acid of a (2E)-3-methylhex-2-enoate. |
| | 3-METHYL-2-HEXENOIC ACID Preparation Products And Raw materials |
|