| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | DL-Trihexyphenidyl hydrochloride Basic information |
| | DL-Trihexyphenidyl hydrochloride Chemical Properties |
| Melting point | 258.5°C dec. | | storage temp. | Refrigerator | | solubility | H2O: soluble | | form | solid | | color | white | | Stability: | Stable at RT | | InChI | 1S/C20H31NO.ClH/c22-20(18-10-4-1-5-11-18,19-12-6-2-7-13-19)14-17-21-15-8-3-9-16-21;/h1,4-5,10-11,19,22H,2-3,6-9,12-17H2;1H | | InChIKey | QDWJJTJNXAKQKD-UHFFFAOYSA-N | | SMILES | Cl[H].OC(CCN1CCCCC1)(C2CCCCC2)c3ccccc3 |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 36 | | WGK Germany | 3 | | RTECS | TN2625000 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | DL-Trihexyphenidyl hydrochloride Usage And Synthesis |
| Chemical Properties | Crystalline Solid | | Uses | DL-Trihexyphenidyl Hydrochloride is an anticholinergic tertiary amine that can gain access to the CNS. It is used to treat parkinsonism and the extrapyramidal side effects of anti-psychotic drugs. The drug is a muscarinic antagonist that qualitatively resembles the belladonna alkaloids in its pharmacological actions and side effects. | | Uses | Antiparkinsonian;Anticholinergic | | Uses | DL-Trihexyphenidyl hydrochloride has been used to develop a capillary zone electrophoretic method with end-column electrochemiluminescence (ECL)-based detection technique. | | Definition | ChEBI: Trihexyphenidyl hydrochloride is an aralkylamine. | | Biochem/physiol Actions | DL-trihexyphenidyl hydrochloride (Benzhexol hydrochloride) is known to function as an antimuscarinic agent and a centrally acting anticholinergic. It can be used for controlling the symptoms of all Parkinsonism types, such as the idiopathic, and postencephalitic arteriosclerotic forms. Benzhexol hydrochloride exerts inhibitory functions on the parasympathetic nervous system. |
| | DL-Trihexyphenidyl hydrochloride Preparation Products And Raw materials |
|