| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
|
| | Bis(2,4,4-trimethylpentyl)phosphinic acid Basic information |
| | Bis(2,4,4-trimethylpentyl)phosphinic acid Chemical Properties |
| density | 0.916 g/mL at 20 °C (lit.) | | refractive index | n20/D 1.460 | | Fp | 108 °C | | form | liquid | | InChI | 1S/C16H35O2P/c1-15(2)11-7-5-9-13-19(17,18)14-10-6-8-12-16(3)4/h15-16H,5-14H2,1-4H3,(H,17,18) | | InChIKey | GBNVBFGHGMAMDH-UHFFFAOYSA-N | | SMILES | CC(C)CCCCCP(O)(=O)CCCCCC(C)C |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 24-26 | | WGK Germany | 1 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 |
| | Bis(2,4,4-trimethylpentyl)phosphinic acid Usage And Synthesis |
| Uses | Diisooctylphosphinic Acid functions as a surface passivating ligand in the synthesis of magic-sized cadmium selenide and cadmium telluride nanocrystals. | | Uses | Diisooctylphosphinic acid (DiOPA) may be used in the following studies:
- As the surface passivating ligand in the synthesis of magic-sized CdSe and CdTe nanocrystals.
- As extractant in the extraction of Indium(III) from sulfate solutions.
- As ligand to investigate the solubility of four copper ligand systems in supercritical CO2.
- As acid ligand for the Supercritical fluid extraction (SFE) of divalent metals (Zn2+, Cu2+, Pb2+, Cd2+ and Cr3+) from sand and fly ash using CO2.
| | General Description | Diisooctylphosphinic acid is an organophosphorous acid. |
| | Bis(2,4,4-trimethylpentyl)phosphinic acid Preparation Products And Raw materials |
|