BDP R6G carboxylic acid manufacturers
|
| | BDP R6G carboxylic acid Basic information |
| Product Name: | BDP R6G carboxylic acid | | Synonyms: | BODIPY R6G ACID;BODIPY R6G carboxylic acid;BDP R6G acid;BODIPY 523/547;BDP R6G carboxylic acid/COOH/;β-D-Glucopyranoside, (2E)-2-methyl-4-(1H-purin-6-ylamino)-2-buten-1-yl (ACI) | | CAS: | 174881-57-3 | | MF: | C18H15BF2N2O2 | | MW: | 340.14 | | EINECS: | | | Product Categories: | | | Mol File: | 174881-57-3.mol |  |
| | BDP R6G carboxylic acid Chemical Properties |
| solubility | Soluble in DMF, DMSO, ethanol, methanol, DCM | | Appearance | Dark brown solid | | ex/em | 530/548 nm | | ε(extinction coefficient) | 76000 L⋅mol−1⋅cm−1 | | Φ(quantum yield) | 0.96 | | InChI | InChI=1S/C18H15BF2N2O2/c20-19(21)22-14(9-11-18(24)25)6-7-15(22)12-16-8-10-17(23(16)19)13-4-2-1-3-5-13/h1-8,10,12H,9,11H2,(H,24,25) | | InChIKey | RFLLOBSXBJAGST-UHFFFAOYSA-N | | SMILES | [F-][B+3]1([N-]2C(=CC=C2C=C2C=CC(C3C=CC=CC=3)=N12)CCC(=O)[O-])[F-].[H+] |
| | BDP R6G carboxylic acid Usage And Synthesis |
| Description | BDP R6G carboxylic acid is a BDP R6G linker with a carboxylic acid. The BDP R6G dye is popular for the microscopy and fluorescence polarization assays. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. | | Chemical Properties | Appearance: Dark brown solid
ex/em: 530/548 nm
Extinction coefficient (ε): 76000 Lmol1cm1
Quantum yield (Φ): 0.96 | | Uses | BDP R6G carboxylic acid is a borondipyrromethene dye (Excitation: 530 nM; Emission: 548 nM). BDP R6G carboxylic acid terminal carboxylic acid can react with primary amine groups in the presence of activators to form a stable amide bond, for subsequent labeling reactions like Steglich esterification[1]. | | Definition | ChEBI: BODIPY R6G is a BODIPY dye having a phenyl substituent at the 5-position and a (2-carboxyethyl) substituent at the 3-position. It has a role as a fluorochrome. It is a BODIPY dye and a monocarboxylic acid. It is functionally related to a 4,4-difluoro-4-bora-3a,4a-diaza-s-indacene. | | References | [1] Hama Y, et al. Targeted optical imaging of cancer cells using lectin-binding BODIPY conjugated avidin. Biochem Biophys Res Commun. 2006 Sep 29;348(3):807-13. DOI:10.1016/j.bbrc.2006.07.169 | | Abs/Em Maxima | 530/548 nm | | Fluoresene quantum yield | 0.96 | | Extinction Coefficient | 70,000 | | CF260 | 0.17 | | CF280 | 0.18 |
| | BDP R6G carboxylic acid Preparation Products And Raw materials |
|