BODIPY 558/568 Succinimidyl Ester manufacturers
|
| | BODIPY 558/568 Succinimidyl Ester Basic information |
| Product Name: | BODIPY 558/568 Succinimidyl Ester | | Synonyms: | BODIPY 558/568 Succinimidyl Ester;BDP 558/568 NHS ester;BODIPY 558/568 NHS;2,5-Dioxopyrrolidin-1-yl 3-(5,5-difluoro-7-(thiophen-2-yl)-5H-5l4,6l4-dipyrrolo[1,2-c:2',1'-f][1,3,2]diazaborinin-3-yl)propanoate , BDP 558/568 NHS ester;2,5-Dioxopyrrolidin-1-yl 3-(5,5-difluoro-7-(thiophen-2-yl)-5H-5l4,6l4-dipyrrolo[1,2-c:2',1'-f][1,3,2]diazaborinin-3-yl)propanoate;Boron, difluoro[1-[1-oxo-3-[5-[[5-(2-thienyl)-2H-pyrrol-2-ylidene-κN]methyl]-1H-pyrrol-2-yl-κN]propoxy]-2,5-pyrrolidinedionato]-, (T-4)-;2,5-Dioxopyrrolidin-1-yl 3-(5,5-difluoro-7-(thiophen-2-yl)-5H-5l4,6l4-dipyrrolo[1,2-c:2',1'-f][1,3,2]diazaborinin-3-yl)propanoate;2,5-Dioxopyrrolidin-1-yl 3-(5,5-difluoro-7-(thiophen-2-yl)-5H-5l4,6l4-dipyrrolo[1,2-c:2',1'-f][1,3,2]diazaborinin-3-yl)propanoate , BDP 558/568 NHS ester | | CAS: | 150173-73-2 | | MF: | C20H16BF2N3O4S | | MW: | 443.23 | | EINECS: | | | Product Categories: | | | Mol File: | 150173-73-2.mol |  |
| | BODIPY 558/568 Succinimidyl Ester Chemical Properties |
| solubility | Soluble in DMF, DMSO, ethyl acetate | | form | Solid | | color | Brown to reddish brown | | Appearance | Dark brown flake solid | | ex/em | 560/574 nm | | ε(extinction coefficient) | 84400 L⋅mol−1⋅cm−1 | | Φ(quantum yield) | 0.68 | | InChI | InChI=1S/C20H16BF2N3O4S/c22-21(23)24-13(6-10-20(29)30-26-18(27)8-9-19(26)28)3-4-14(24)12-15-5-7-16(25(15)21)17-2-1-11-31-17/h1-5,7,11-12H,6,8-10H2 | | InChIKey | DPIQWSPHMYACPD-UHFFFAOYSA-N | | SMILES | [F-][B+3]1([N-]2C(=CC=C2C=C2C=CC(C3SC=CC=3)=[N]21)CCC(=O)ON1C(CCC1=O)=O)[F-] |
| | BODIPY 558/568 Succinimidyl Ester Usage And Synthesis |
| Description | BDP 558/568 NHS ester is a BDP dye linker with similar emission to other dyes such as Cyanine3. The introduction of the NHS ester makes the compound more reactive with primary amines. | | Chemical Properties | Appearance: Dark brown flaky solid
ex/em: 560/574 nm
Extinction coefficient (ε): 84400 Lmol1cm1
Quantum yield (Φ): 0.68 | | Uses | BDP 558/568 NHS ester is a borondipyrromethene fluorophore with emission in the yellow part of the spectrum. BDP 558/568 NHS ester is an amine reactive NHS ester, and the absorption and emission spectra of BDP 558/568 NHS ester are similar with TAMRA, BDP TMR, Cyanine3, and sulfo-Cyanine3[1][2]. | | References | [1] Vasselon T, et al. Internalization of monomeric lipopolysaccharide occurs after transfer out of cell surface CD14. J Exp Med. 1999 Aug 16;190(4):509-21. DOI:10.1084/jem.190.4.509
[2] Yu B, Wright SD. Catalytic properties of lipopolysaccharide (LPS) binding protein. Transfer of LPS to soluble CD14. J Biol Chem. 1996 Feb 23;271(8):4100-5. DOI:10.1074/jbc.271.8.4100 | | Abs/Em Maxima | 561/569 nm | | Fluoresene quantum yield | 0.68 | | Extinction Coefficient | 84400 | | CF260 | 0.00 | | CF280 | 0.07 |
| | BODIPY 558/568 Succinimidyl Ester Preparation Products And Raw materials |
|