| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
|
| | Benzene-1,3-disulfonyl fluoride Basic information |
| Product Name: | Benzene-1,3-disulfonyl fluoride | | Synonyms: | Benzene-1,3-disulfonyl fluoride;1,3-Benzenedisulfonyl difluoride;1,3-Benzenedisulfonyl fluoride 95%;Benzene-1,3-disulfonyl difluoride | | CAS: | 7552-55-8 | | MF: | C6H4F2O4S2 | | MW: | 242.22 | | EINECS: | | | Product Categories: | | | Mol File: | 7552-55-8.mol |  |
| | Benzene-1,3-disulfonyl fluoride Chemical Properties |
| Melting point | 37-42°C | | Boiling point | 98-104 °C(Press: 0.5 Torr) | | density | 1.605±0.06 g/cm3(Predicted) | | Fp | >110°C | | form | solid | | InChI | 1S/C6H4F2O4S2/c7-13(9,10)5-2-1-3-6(4-5)14(8,11)12/h1-4H | | InChIKey | VCINFPPPNNZOAD-UHFFFAOYSA-N | | SMILES | FS(C1=CC(S(F)(=O)=O)=CC=C1)(=O)=O |
| RIDADR | UN 3261 8 / PGII | | WGK Germany | 3 | | HS Code | 2904990090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B |
| | Benzene-1,3-disulfonyl fluoride Usage And Synthesis |
| Uses | Sulfonyl fluoride motif can be used as a connector for the assembly of -SO2- linked small molecules with proteins or nucleic acids. This new click chemistry approach through sulfates is a complimentary approach to using amides and phosphate groups as linkers. | | reaction suitability | reaction type: click chemistry |
| | Benzene-1,3-disulfonyl fluoride Preparation Products And Raw materials |
|