|
|
| | 2,2,3,3-tetrafluoro-4-methoxy-4-oxobutanoic acid Basic information |
| Product Name: | 2,2,3,3-tetrafluoro-4-methoxy-4-oxobutanoic acid | | Synonyms: | 2,2,3,3-tetrafluoro-4-methoxy-4-oxobutanoic acid;Butanedioic acid, 2,2,3,3-tetrafluoro-, 1-methyl ester | | CAS: | 356-33-2 | | MF: | C5H4F4O4 | | MW: | 204.08 | | EINECS: | | | Product Categories: | | | Mol File: | 356-33-2.mol |  |
| | 2,2,3,3-tetrafluoro-4-methoxy-4-oxobutanoic acid Chemical Properties |
| Boiling point | 245.4±40.0 °C(Predicted) | | density | 1.557±0.06 g/cm3(Predicted) | | pka | -0.85±0.28(Predicted) | | InChI | InChI=1S/C5H4F4O4/c1-13-3(12)5(8,9)4(6,7)2(10)11/h1H3,(H,10,11) | | InChIKey | JQYHTWJFTRVWFC-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C(F)(F)C(F)(F)C(O)=O |
| | 2,2,3,3-tetrafluoro-4-methoxy-4-oxobutanoic acid Usage And Synthesis |
| | 2,2,3,3-tetrafluoro-4-methoxy-4-oxobutanoic acid Preparation Products And Raw materials |
|