| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
|
| | Poly (L-lactide-co-e-caprolactone) Basic information |
| Product Name: | Poly (L-lactide-co-e-caprolactone) | | Synonyms: | RESOMER LC 703 S, POLY(L-LACTIDE-CO-Ε-CAPROLACTONE);Resomer(R) LC 703 S, Poly(L-lactide-co-epsilon-caprolactone);LC 703 S, Poly(L-lactide-co-ε-caprolactone);Resomer®;Poly (L-lactide-co-e-caprolactone);80:20 Poly(L-lactide-co-ε-caprolactone);Resomer? LC 703 S, Poly(L-lactide-co-ε-caprolactone) | | CAS: | 65408-67-5 | | MF: | C12H18O6 | | MW: | 258.27 | | EINECS: | | | Product Categories: | | | Mol File: | 65408-67-5.mol |  |
| | Poly (L-lactide-co-e-caprolactone) Chemical Properties |
| Melting point | 162-169°C | | storage temp. | 2-8°C | | form | solid | | InChI | InChI=1/C6H8O4.C6H10O2/c1-3-5(7)10-4(2)6(8)9-3;7-6-4-2-1-3-5-8-6/h3-4H,1-2H3;1-5H2/t3-,4-;/s3 | | InChIKey | ZAJGKKXBKLVSKW-QYDODFSFNA-N | | SMILES | O=C1OCCCCC1.C[C@@H]1OC(=O)[C@H](C)OC1=O |&1:9,13,r| | | EPA Substance Registry System | 1,4-Dioxane-2,5-dione, 3,6-dimethyl-, (3S,6S)-, polymer with 2-oxepanone (65408-67-5) |
| WGK Germany | WGK 3 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids |
| | Poly (L-lactide-co-e-caprolactone) Usage And Synthesis |
| Uses | Biodegradable, biocompatible, and bioresorbable copolymer composed of L-Lactide and ε-Caprolactone. This semi-crystalline material has been used in the fabrication of research medical devices and research tissue engineering solutions, such as orthopedic or soft tissue fixation devices. Degradation of this materials has been thoroughly studied and has been shown to be safely resorbed by the body after implantation. Modification of molecular weight and polymer composition allows for control of the degradation rate and mechanical stability of the polymer. |
| | Poly (L-lactide-co-e-caprolactone) Preparation Products And Raw materials |
|