- D(+)-LACTIDE
-
- $30.00
-
2026-08-04
- CAS:13076-17-0
- Purity: 98.00%
- Supply Ability: 10g
- D(+)-LACTIDE
-
-
2026-07-20
- CAS:13076-17-0
- Min. Order: 1kg
- Purity: 98
- Supply Ability: 1000kgs
- D(+)-LACTIDE
-
- $5.00
-
2026-05-28
- CAS:13076-17-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10000kg
|
| | D(+)-LACTIDE Basic information |
| Product Name: | D(+)-LACTIDE | | Synonyms: | PURASORB(R) D;D(+)-LACTIDE;(3R-CIS)-3,6-DIMETHYL-1,4-DIOXANE-2,5-DIONE;(2R,5R)-2,5-Dimethyl-1,4-dioxane-3,6-dione;(3R)-3β,6β-Dimethyl-1,4-dioxane-2,5-dione;3β,6β-Dimethyl-1,4-dioxin-2,5(3H,6H)-dione;1,4-Dioxane-2,5-dione,3,6-diMethyl-, (3R,6R)-;D(+)-LACTIDE/Lactide | | CAS: | 13076-17-0 | | MF: | C6H8O4 | | MW: | 144.13 | | EINECS: | 603-436-5 | | Product Categories: | | | Mol File: | 13076-17-0.mol |  |
| | D(+)-LACTIDE Chemical Properties |
| Melting point | 96.5-97.5 °C | | Boiling point | 285.5±15.0 °C(Predicted) | | density | 1.186±0.06 g/cm3(Predicted) | | vapor pressure | 0.28Pa at 25℃ | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Toluene (Slightly) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C6H8O4/c1-3-5(7)10-4(2)6(8)9-3/h3-4H,1-2H3/t3-,4-/m1/s1 | | InChIKey | JJTUDXZGHPGLLC-QWWZWVQMSA-N | | SMILES | O1[C@H](C)C(=O)O[C@H](C)C1=O | | LogP | 0.4 at 25℃ | | Surface tension | 70.7mN/m at 1g/L and 20℃ | | EPA Substance Registry System | 1,4-Dioxane-2,5-dione, 3,6-dimethyl-, (3R,6R)- (13076-17-0) |
| TSCA | TSCA listed | | HS Code | 2932990090 |
| | D(+)-LACTIDE Usage And Synthesis |
| Chemical Properties | white to almost white powder to crystal. | | Uses | D-(+)-Lactide is the cyclic di-ester of lactic acid (L113490), an by product that is produced by muscle cells and red blood cells when the body breaks down carbohydrates for energy during times of low oxygen levels. Lactide can be polymerized to polylactic acid using a suitable catalyst go give materials of useful properties. |
| | D(+)-LACTIDE Preparation Products And Raw materials |
|