|
|
| | 4'-Bromo-[1,1'-biphenyl]-4-carboxylic acid Basic information |
| Product Name: | 4'-Bromo-[1,1'-biphenyl]-4-carboxylic acid | | Synonyms: | 4'-BROMO-4-BIPHENYL CARBOXYLIC ACID;4'-BROMO[1,1'-BIPHENYL]-4-CARBOXYLIC ACID;4-(4'-BROMOPHENYL)BENZOIC ACID;AKOS BAR-2384;Bromo biphenyl carboxylic acid;4'-Bromo-4-carboxybiphenyl, 4-(4-Bromophenyl)benzoic acid;[1,1'-Biphenyl]-4-carboxylic acid, 4'-bromo-;4'-Bromo-[1,1'-biphenyl]-4-carboxylic acid | | CAS: | 5731-11-3 | | MF: | C13H9BrO2 | | MW: | 277.11 | | EINECS: | 993-154-1 | | Product Categories: | | | Mol File: | 5731-11-3.mol | ![4'-Bromo-[1,1'-biphenyl]-4-carboxylic acid Structure](CAS/GIF/5731-11-3.gif) |
| | 4'-Bromo-[1,1'-biphenyl]-4-carboxylic acid Chemical Properties |
| Melting point | 301-302°C | | Boiling point | 418.1±28.0 °C(Predicted) | | density | 1.510±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry, Room Temperature | | form | Solid | | pka | 4.08±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C13H9BrO2/c14-12-7-5-10(6-8-12)9-1-3-11(4-2-9)13(15)16/h1-8H,(H,15,16) | | InChIKey | UTHDVFIFIMWTJQ-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(Br)C=C2)=CC=C(C(O)=O)C=C1 |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | HazardClass | IRRITANT | | HS Code | 2916399090 |
| | 4'-Bromo-[1,1'-biphenyl]-4-carboxylic acid Usage And Synthesis |
| Uses | 4''-Bromo[1,1''-biphenyl]-4-carboxylic Acid functions as a novel A-C ring steroidomimetic inhibitors of 5α-reductase (5αR) type 1 and 2. |
| | 4'-Bromo-[1,1'-biphenyl]-4-carboxylic acid Preparation Products And Raw materials |
|