| Company Name: |
TOSUN PHARM |
| Tel: |
020-66392521-118 18922260391 |
| Email: |
3004261881@qq.com |
Pyridoxine Impurity 9 manufacturers
|
| | Pyridoxine Impurity 9 Basic information |
| Product Name: | Pyridoxine Impurity 9 | | Synonyms: | Pyridoxine Impurity 9;[1,3]Dioxepino[5,6-c]pyridin-9-ol, 1,5-dihydro-8-methyl-3-propyl-;Vitamin B6 Impurity 79;Vitamin B6 Impurity 9;Pyridoxine Impurity 16/8-Methyl-3-propyl-1,5-dihydro-[1,3]dioxepino[5,6-c]pyridin-9-ol;Vitamin B9 Impurity;8-Methyl-3-propyl-1,5-dihydro-[1,3]dioxepino[5,6-c]pyridin-9-ol | | CAS: | 1385767-86-1 | | MF: | C12H17NO3 | | MW: | 223.27 | | EINECS: | | | Product Categories: | | | Mol File: | 1385767-86-1.mol |  |
| | Pyridoxine Impurity 9 Chemical Properties |
| Boiling point | 404.3±45.0 °C(Predicted) | | density | 1.127±0.06 g/cm3(Predicted) | | pka | 9.70±0.40(Predicted) | | InChI | InChI=1S/C12H17NO3/c1-3-4-11-15-6-9-5-13-8(2)12(14)10(9)7-16-11/h5,11,14H,3-4,6-7H2,1-2H3 | | InChIKey | FZABEONAMIQWGV-UHFFFAOYSA-N | | SMILES | C1=NC(C)=C(O)C2COC(CCC)OCC1=2 |
| | Pyridoxine Impurity 9 Usage And Synthesis |
| | Pyridoxine Impurity 9 Preparation Products And Raw materials |
|