| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Ethyl (R)-(-)-3-(2,2-dimethyl-1,3-dioxolan-4-yl)-trans-2-propenoate Basic information |
| Product Name: | Ethyl (R)-(-)-3-(2,2-dimethyl-1,3-dioxolan-4-yl)-trans-2-propenoate | | Synonyms: | 3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-propenoic acid ethyl ester;ethyl (R)-trans-4,5-O-isopropyl.-4,5-di-hydroxy-2-pentenoate;ETHYL (R)-TRANS-4 5-O-ISOPROPYL.-4 5-DI&;2(E)-Propenoic acid, 3-[(4R)-(2,2-dimethyl-1,3-dioxolan-4-yl) ethyl ester;ethyl 3-(2,2-dimethyl-1,3-dioxalan-4-yl)-2-propenoate;Ethyl (R)-trans-4,5-O-isopropylidene-4,5-dihydroxy-2-pentenoate, Ethyl (R)-trans-3-(2,2-dimethyl-1,3-dioxolan-4-yl)propenoate;(R)-ETHYL-4,5-ISOPROPYLIDENEPENT-2-ENOATE;(E)-ETHYL-4,5-O-ISOPROPYLIDENE-(R)-4,5-DIHYDROXY-2-PENTENOATE | | CAS: | 104321-62-2 | | MF: | C10H16O4 | | MW: | 200.23 | | EINECS: | | | Product Categories: | chiral | | Mol File: | 104321-62-2.mol |  |
| | Ethyl (R)-(-)-3-(2,2-dimethyl-1,3-dioxolan-4-yl)-trans-2-propenoate Chemical Properties |
| alpha | -41 º (C=1 IN CHLOROFORM) | | Boiling point | 241.0±0.0 °C(Predicted) | | density | 1.05 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.453 | | Fp | >230 °F | | storage temp. | 2-8°C | | form | liquid | | Optical Rotation | [α]20/D 41°, c = 1 in chloroform | | InChI | 1S/C10H16O4/c1-4-12-9(11)6-5-8-7-13-10(2,3)14-8/h5-6,8H,4,7H2,1-3H3/b6-5+/t8-/m1/s1 | | InChIKey | GZVXALXOWVXZLH-HQZHTGGTSA-N | | SMILES | CCOC(=O)\C=C\[C@@H]1COC(C)(C)O1 |
| Safety Statements | 23-24/25 | | WGK Germany | 3 | | F | 9 | | Storage Class | 10 - Combustible liquids |
| | Ethyl (R)-(-)-3-(2,2-dimethyl-1,3-dioxolan-4-yl)-trans-2-propenoate Usage And Synthesis |
| | Ethyl (R)-(-)-3-(2,2-dimethyl-1,3-dioxolan-4-yl)-trans-2-propenoate Preparation Products And Raw materials |
|