|
|
| | Pterin-6-carboxylic acid Basic information |
| | Pterin-6-carboxylic acid Chemical Properties |
| Melting point | 300 °C (approx, decomp) | | Boiling point | 433.6±55.0 °C(Predicted) | | density | 2.16±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Aqueous Acid (Very Slightly), Aqueous Base (Very Slightly, Heated) | | pka | 5.40±0.20(Predicted) | | form | Solid | | color | Yellow to Dark Yellow | | biological source | synthetic | | BRN | 227689 | | Stability: | Hygroscopic | | InChI | 1S/C7H5N5O3/c8-7-11-4-3(5(13)12-7)10-2(1-9-4)6(14)15/h1H,(H,14,15)(H3,8,9,11,12,13) | | InChIKey | QABAUCFGPWONOG-UHFFFAOYSA-N | | SMILES | NC1=Nc2ncc(nc2C(=O)N1)C(O)=O | | NIST Chemistry Reference | Pterin-6-carboxylic acid(948-60-7) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 10 | | Storage Class | 11 - Combustible Solids |
| | Pterin-6-carboxylic acid Usage And Synthesis |
| Uses | Pterine-6-carboxylic Acid is a degradation product of Folic acid (F680300). | | Definition | ChEBI: 2-Amino-4-hydroxy-6-pteridinecarboxylic acid is an organooxygen compound and an organonitrogen compound. It is functionally related to an alpha-amino acid. | | Purification Methods | The acid gives yellow crystals by repeated dissolution in aqueous NaOH and adding aqueous HCl. It has UV with max at 235, 260 and 265nm ( 11,000, 10,500 and 9,000) in 0.1N HCl and 263 and 365nm ( 20,500 and 9,000) in 0.1N NaOH. [UV: Pfleiderer et al. Justus Liebigs Ann Chem 741 64 1970, Stockstad et al. J Am Chem Soc 70 5 1948, Fluorescence: Kavanagh & Goodwin Arch Biochem 20 315 1949, Beilstein 26 III/IV 4053.] |
| | Pterin-6-carboxylic acid Preparation Products And Raw materials |
|