Triclosan methyl ether manufacturers
|
| | Triclosan methyl ether Basic information |
| Product Name: | Triclosan methyl ether | | Synonyms: | Triclosan Impurity;METHYL ETHER TRICLOSAN;Triclosan-methyl OEKANAL;2,4,4'-trichloro-2'-hydroxydiphenyl methyl ether;Benzene, 4-chloro-1-(2,4-dichlorophenoxy)-2-methoxy-;Methyl triclosan;2,4,4μ-Trichloro-2μ-methoxydiphenyl ether, 5-Chloro-2-(2,4-dichlorophenoxy)anisole, Methyl triclosan;Triclosan-methyl | | CAS: | 4640-01-1 | | MF: | C13H9Cl3O2 | | MW: | 303.57 | | EINECS: | | | Product Categories: | Aromatics Compounds;Aromatics | | Mol File: | 4640-01-1.mol |  |
| | Triclosan methyl ether Chemical Properties |
| Melting point | 210-217 °C | | Boiling point | 210-217 °C | | density | 1.380±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly, Heated), Methanol (Slightly) | | form | Oil to Solid | | color | Colourless to Off-White | | Major Application | cleaning products
clinical
cosmetics
food and beverages
forensics and toxicology
personal care
pharmaceutical (small molecule) | | InChI | 1S/C13H9Cl3O2/c1-17-13-7-9(15)3-5-12(13)18-11-4-2-8(14)6-10(11)16/h2-7H,1H3 | | InChIKey | NLYDHBBTVWMLFD-UHFFFAOYSA-N | | SMILES | COc1cc(Cl)ccc1Oc2ccc(Cl)cc2Cl | | EPA Substance Registry System | Benzene, 4-chloro-1-(2,4-dichlorophenoxy)-2-methoxy- (4640-01-1) |
| Hazard Codes | N | | Risk Statements | 50/53 | | Safety Statements | 60-61 | | RIDADR | UN 3082 9/PG 3 | | WGK Germany | WGK 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1 |
| | Triclosan methyl ether Usage And Synthesis |
| Chemical Properties | Colourless Syrup | | Uses | A bactericide detected in rivers and lakes.
The current lot contains 8.7% d2, 0.2% d1 and 0.002% d0. | | Synthesis | At the time of its introduction commercially, triclosan methyl ester was prepared by diazotizing 2,4,4'-trichloro-2'-aminodiphenyl ether with nitrosoyl sulfuric acid, and then combining the resultant hydrodiazonium hydrogen sulfate salt with hot, strong sulfuric acid.
|
| | Triclosan methyl ether Preparation Products And Raw materials |
|