| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3-Benzyloxy-benzoyl chloride Basic information |
| Product Name: | 3-Benzyloxy-benzoyl chloride | | Synonyms: | LABOTEST-BB LT00511886;ART-CHEM-BB B025597;ASISCHEM B52694;AKOS BB-8604;ZERENEX E/4047709;3-Benzyloxybenzoyl chloride 94%;3-(phenylmethoxy)benzoyl chloride;benzoyl chloride, 3-(phenylmethoxy)- | | CAS: | 61535-46-4 | | MF: | C14H11ClO2 | | MW: | 246.69 | | EINECS: | | | Product Categories: | | | Mol File: | 61535-46-4.mol |  |
| | 3-Benzyloxy-benzoyl chloride Chemical Properties |
| Melting point | 40-42℃ | | Fp | >110℃ | | form | solid | | Water Solubility | Reacts with water. | | Sensitive | Moisture Sensitive | | InChI | 1S/C14H11ClO2/c15-14(16)12-7-4-8-13(9-12)17-10-11-5-2-1-3-6-11/h1-9H,10H2 | | InChIKey | HPVUGOBQRQUWMK-UHFFFAOYSA-N | | SMILES | ClC(=O)c1cccc(OCc2ccccc2)c1 |
| Hazard Codes | C,N | | Risk Statements | 34-50/53 | | Safety Statements | 26-36/37/39-45-60-61 | | RIDADR | UN3261 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | II | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Aquatic Acute 1
Skin Corr. 1B |
| Provider | Language |
|
ALFA
| English |
| | 3-Benzyloxy-benzoyl chloride Usage And Synthesis |
| Uses | Reactant for preparation of dihydroquinolinones and tetrahydroquinazolinones as potent kinesin spindle protein inhibitors and potential antitumor agents, preparation of carbamate derivatives as fatty acid amide hydrolase inhibitors. | | Uses | Reactant for:
- Preparation of dihydroquinolinones and tetrahydroquinazolinones as potent kinesin spindle protein inhibitors and potential antitumor agents
- Preparation of carbamate derivatives as fatty acid amide hydrolase inhibitors
|
| | 3-Benzyloxy-benzoyl chloride Preparation Products And Raw materials |
|