| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | Sodium trifluoroacetate-1-13C Basic information |
| | Sodium trifluoroacetate-1-13C Chemical Properties |
| Melting point | 207 °C (dec.) (lit.) | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | InChI | 1S/C2HF3O2.Na/c3-2(4,5)1(6)7;/h(H,6,7);/q;+1/p-1/i1+1; | | InChIKey | UYCAUPASBSROMS-YTBWXGASSA-M | | SMILES | [Na+].[O-][13C](=O)C(F)(F)F |
| | Sodium trifluoroacetate-1-13C Usage And Synthesis |
| Uses | Trifluoroacetic acid-13C sodium is the 13C labeled isotope of Trifluoroacetic acid-13C (sodium) (HY-W754811)[1]. | | References | [1] Russak, et sl. Impact of deuterium substitution on the pharmacokinetics of pharmaceuticals. Annals of Pharmacotherapy 53.2 (2019): 211-236. DOI:10.1080/09593330.2018.1515990 |
| | Sodium trifluoroacetate-1-13C Preparation Products And Raw materials |
|