PD 168 077 MALEATE manufacturers
- PD168,077
-
- $1980.00
-
2026-05-11
- CAS:190383-31-4
- Purity:
- Supply Ability: 10g
- PD 168 077 MALEATE
-
- $1.00
-
2020-01-15
- CAS:190383-31-4
- Min. Order: 1KG
- Purity: 99.0%
- Supply Ability: 100kg
|
| | PD 168 077 MALEATE Basic information |
| Product Name: | PD 168 077 MALEATE | | Synonyms: | n-[[4-(2-cyanophenyl)-1-piperazinyl]methyl]-3-methylbenzamide maleate salt;pd 168,077 maleate salt;N-[[4-(2-Cyanophenyl)-1-piperazinyl]methyl]-3-methyl-benzamide;N-((4-(2-CYANOPHENYL)PIPERAZIN-1-YL)METHYL)-3-METHYLBENZAMIDE MALEATE;N-[[4-(2-cyanophenyl)piperazin-1-yl]methyl]-3-methylbenzamide;Benzamide, N-[[4-(2-cyanophenyl)-1-piperazinyl]methyl]-3-methyl-;077;PD 168 | | CAS: | 190383-31-4 | | MF: | C20H22N4O | | MW: | 334.41 | | EINECS: | | | Product Categories: | Dopamine receptor | | Mol File: | 190383-31-4.mol |  |
| | PD 168 077 MALEATE Chemical Properties |
| Boiling point | 554.6±50.0 °C(Predicted) | | density | 1.22±0.1 g/cm3(Predicted) | | solubility | DMSO: >10 mg/mL | | form | powder | | pka | 14.89±0.46(Predicted) | | color | white | | InChIKey | NAEUGRPISCANHO-BTJKTKAUSA-N | | SMILES | [H]\C(=C(/[H])C(O)=O)C(O)=O.Cc1cccc(c1)C(=O)NCN2CCN(CC2)c3ccccc3C#N |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | PD 168 077 MALEATE Usage And Synthesis |
| Uses | The dopamine receptors play important role in cognition, memory, learning, and motor control (1). These receptors have been implicated as a therapeutic target for many psychiatric and neurological disorders. PD 168077 is a D4 dopamine receptor agonist and can be used to study ligand-receptor interactions of dopamine receptors (2). | | Biological Activity | Selective D4 dopamine receptor agonist. | | in vivo | PD-168077 (0.2-25.0 mg/kg) dose-dependently induces locomotion, which takes an unusual and characteristic ”shuffling” form with uncoordinated movements together with yawning, and episodes of myoclonic jerking; grooming, and rearing are reduced[1]. |
| | PD 168 077 MALEATE Preparation Products And Raw materials |
|