| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing1@energy-chemical.com |
| Products Intro: |
Product Name:S-15176 difumarate salt >=98% (HPLC), solid
CAS:148913-55-7
Purity:NULL Package:10mg;2mg Remarks:NULL
|
| Company Name: |
TargetMol Chemicals Inc.
|
| Tel: |
15002134094 |
| Email: |
marketing@targetmol.cn |
| Products Intro: |
Product Name:S-15176 difumarate
CAS:148913-55-7
Package:50mg
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:S-15176 difumarate salt
CAS:148913-55-7
|
| Company Name: |
Santa Cruz Biotechnology Inc
|
| Tel: |
021-60936350 |
| Email: |
scbt@scbt.com |
| Products Intro: |
Product Name:S-15176 difumarate salt
CAS:148913-55-7
|
| Company Name: |
Absin Bioscience Inc.
|
| Tel: |
021-38015121-8802 |
| Email: |
chenjw@absin.cn |
| Products Intro: |
Product Name:S-15176 difumarate salt
CAS:148913-55-7
|
|
| | S-15176 DIFUMARATE SALT Basic information |
| Product Name: | S-15176 DIFUMARATE SALT | | Synonyms: | N-[(3,5-Di-tert-butyl-4-hydroxy-1-thiophenyl)]-3-propyl-Nμ-(2,3,4-trimethoxybenzyl)piperazine difumarate salt;S-15176 difumarate salt >=98% (HPLC), solid;S-15176 difumarate | | CAS: | 148913-55-7 | | MF: | C31H48N2O4S.2C4H4O4 | | MW: | 776.939 | | EINECS: | | | Product Categories: | | | Mol File: | 148913-55-7.mol |  |
| | S-15176 DIFUMARATE SALT Chemical Properties |
| storage temp. | 2-8°C | | solubility | DMSO: 16 mg/mL, soluble | | form | solid | | InChIKey | ANXPOPNCJIJXJW-LVEZLNDCSA-N | | SMILES | OC(=O)\C=C\C(O)=O.OC(=O)\C=C\C(O)=O.COc1ccc(CN2CCN(CCCSc3cc(c(O)c(c3)C(C)(C)C)C(C)(C)C)CC2)c(OC)c1OC |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | S-15176 DIFUMARATE SALT Usage And Synthesis |
| Uses | The protonophoric activity of S-15176 difumarate salt was studied in mitochondria isolated from livers of Wistar rats.5 | | Biological Activity | Antioxidant and anti-ischemic agent. Also inhibits mitochondrial permeability transition, prevents the early step in apoptosis by preventing collapse of the electrochemical gradient across the mitochondrial membrane. IC50 for in vitro lipid peroxidation is 0.3 μM. IC50 for carnitine palmitoyltransferase (CPT-1) in heart homogenate is 16.8 μM. The shift from fatty acid to glucose oxidation may contribute to anti-ischemic effect.', 'S-15176 suppresses the mitochondrial permeability transition in response to calcium ions and inorganic phosphate and inhibits the release of cytochrome c in response to silver ions. It exhibits weak protonophoric activity.5 |
| | S-15176 DIFUMARATE SALT Preparation Products And Raw materials |
|