| Company Name: |
Alfa Aesar
|
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Products Intro: |
Product Name:5-(2,5-Dichlorophenyl)-2-furoic acid, 97% CAS:186830-98-8 Package:1g Remarks:H51997
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:5-(2,5-Dichlorophenyl)-2-furoic acid CAS:186830-98-8 Purity:97% Package:1G
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:5-(2,5-Dichlorophenyl)-2-furoic acid CAS:186830-98-8 Purity:97% Package:1G Remarks:588911-1G
|
|
| | 5-(2 5-DICHLOROPHENYL)-2-FUROIC ACID 9& Basic information |
| | 5-(2 5-DICHLOROPHENYL)-2-FUROIC ACID 9& Chemical Properties |
| Melting point | 233-237 °C (lit.) | | form | solid | | InChI | 1S/C11H6Cl2O3/c12-6-1-2-8(13)7(5-6)9-3-4-10(16-9)11(14)15/h1-5H,(H,14,15) | | InChIKey | ATAZLMGGQQLRBC-UHFFFAOYSA-N | | SMILES | OC(=O)c1ccc(o1)-c2cc(Cl)ccc2Cl |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 5-(2 5-DICHLOROPHENYL)-2-FUROIC ACID 9& Usage And Synthesis |
| | 5-(2 5-DICHLOROPHENYL)-2-FUROIC ACID 9& Preparation Products And Raw materials |
|