| Company Name: |
Shanghai Hanhong Scientific Co.,Ltd.
|
| Tel: |
021-54306202 13764082696 |
| Email: |
info@hanhongsci.com |
| Products Intro: |
Product Name:1,5-Diacetylindoline
CAS:16078-35-6
Purity:98% Remarks:B71236
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:1,5-Diacetylindoline
CAS:16078-35-6
Purity:97% Package:5G Remarks:593273-5G
|
1 5-DIACETYLINDOLINE 97 manufacturers
|
| | 1 5-DIACETYLINDOLINE 97 Basic information |
| | 1 5-DIACETYLINDOLINE 97 Chemical Properties |
| Melting point | 137-141 °C (lit.) | | Boiling point | 471.6±45.0 °C(Predicted) | | density | 1.179±0.06 g/cm3(Predicted) | | pka | -1.84±0.20(Predicted) | | form | solid | | InChI | 1S/C12H13NO2/c1-8(14)10-3-4-12-11(7-10)5-6-13(12)9(2)15/h3-4,7H,5-6H2,1-2H3 | | InChIKey | DDTZNSOMVMYKHA-UHFFFAOYSA-N | | SMILES | CC(=O)N1CCc2cc(ccc12)C(C)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 1 5-DIACETYLINDOLINE 97 Usage And Synthesis |
| Uses | - Reactant for α-arylation reactions
- Reactant for preparation of 5-HT1B receptor antagonists
- Reactant for synthesis of N-(1-benzo[1,3]dioxol-5-yl)ethyl-, N-[1-(2,3-dihydro-benzofuran-5-yl)ethyl-, and N-[1-(2,3-dihydro-1H-indol-5-yl)ethylacrylamides as KCNQ2 opener agents
- Reactant for preparation of 1-acyl-7-nitroindolines as L-glutamate photoreleasing agents in cerebellar granule neurons
|
| | 1 5-DIACETYLINDOLINE 97 Preparation Products And Raw materials |
|