| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 5'-Fluoro-2'-hydroxy-3'-nitro- Basic information |
| Product Name: | 5'-Fluoro-2'-hydroxy-3'-nitro- | | Synonyms: | JRH-01022, 1-(5-Fluoro-2-hydroxy-3-nitrophenyl)ethanone, 97%;5'-fluoro-2'-hydroxy-3'-nitroacetopheone;1-(5-Fluoro-2-hydroxy-3-nitrophenyl)ethan-1-one;Ethanone, 1-(5-fluoro-2-hydroxy-3-nitrophenyl)-;5'-FLUORO-2'-HYDROXY-3'-NITROACETOPHENONE;5′-Fluoro-2′-hydroxy-3′-nitroacetophenone, CAS 70978-39-1;5'-Fluoro-2'-hydroxy-3'-nitro- | | CAS: | 70978-39-1 | | MF: | C8H6FNO4 | | MW: | 199.14 | | EINECS: | | | Product Categories: | C7 to C8;Carbonyl Compounds;Ketones | | Mol File: | 70978-39-1.mol |  |
| | 5'-Fluoro-2'-hydroxy-3'-nitro- Chemical Properties |
| Melting point | 87-90 °C (lit.) | | Boiling point | 240.9±35.0 °C(Predicted) | | density | 1.470±0.06 g/cm3(Predicted) | | pka | 6.96±0.38(Predicted) | | InChI | 1S/C8H6FNO4/c1-4(11)6-2-5(9)3-7(8(6)12)10(13)14/h2-3,12H,1H3 | | InChIKey | YVTPUCHIOSGVSH-UHFFFAOYSA-N | | SMILES | CC(=O)c1cc(F)cc(c1O)[N+]([O-])=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 5'-Fluoro-2'-hydroxy-3'-nitro- Usage And Synthesis |
| Uses | 5′-Fluoro-2′-hydroxy-3′-nitroacetophenone may be used to prepare 1-(3-amino-5-fluoro-2-hydroxyphenyl)ethanone via catalytic hydrogenation. | | Preparation | Preparation by nitration of 5-fluoro-2-hydroxy-acetophenone with nitric acid (d = 1.42) in concentrated sulfuric acid between 15° and 5° (46%). | | General Description | 5′-Fluoro-2′-hydroxy-3′-nitroacetophenone, also known as 1-(5-fluoro-2-hydroxy-3-nitrophenyl)ethanone, is an aromatic hydroxy ketone. It can be synthesized from 5-fluoro-2-hydroxy-acetophenone via nitration. |
| | 5'-Fluoro-2'-hydroxy-3'-nitro- Preparation Products And Raw materials |
|