| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Pentafluorophenyl isocyanate 97 Basic information |
| Product Name: | Pentafluorophenyl isocyanate 97 | | Synonyms: | Isocyanate, pentafluorophenyl-;perfluorophenyl isocyanate;1,2,3,4,5-pentafluoro-6-isocyanatobenzene;Pentafluorophenyl isocyanate 97%;2,3,4,5,6-PentafluoroPhenyl isocyanate;Pentafluoroisocyanatobenzene;Benzene, 1,2,3,4,5-pentafluoro-6-isocyanato-;Isocyanic Acid Pentafluorophenyl Ester | | CAS: | 1591-95-3 | | MF: | C7F5NO | | MW: | 209.07 | | EINECS: | 216-470-7 | | Product Categories: | Isocyanates;Nitrogen Compounds;Organic Building Blocks | | Mol File: | 1591-95-3.mol |  |
| | Pentafluorophenyl isocyanate 97 Chemical Properties |
| Melting point | 36 °C | | Boiling point | 52 °C/2 mmHg (lit.) | | density | 1.6 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.449(lit.) | | Fp | >230 °F | | storage temp. | 2-8°C | | InChI | 1S/C7F5NO/c8-2-3(9)5(11)7(13-1-14)6(12)4(2)10 | | InChIKey | QXLDBWRLZDBVGF-UHFFFAOYSA-N | | SMILES | Fc1c(F)c(F)c(N=C=O)c(F)c1F |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 23-26-36 | | RIDADR | UN 2206 6.1/PG 3 | | WGK Germany | 3 | | HazardClass | 6.1 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Resp. Sens. 1
Skin Irrit. 2
Skin Sens. 1
STOT SE 3 |
| | Pentafluorophenyl isocyanate 97 Usage And Synthesis |
| Uses | Pentafluorophenyl Isocyanate is used as a reactant in the inhibition of carbonic anhydrase IX and antimetastatic activity in breast cancer metastasis of ureidobenzenesulfonamides. | | General Description | Pentafluorophenyl isocyanate (PFPI), an aryl isocyanate, is an N-protecting reagent. The photoinduced intermolecular carbamoylation of tertiary ethereal C-H bond of fused bicyclic system using PFPI/benzophenone has been reported. Reacting wood polymers with PFPI can make them resistant to fungal attack by forming a stable carbamate bond. |
| | Pentafluorophenyl isocyanate 97 Preparation Products And Raw materials |
|