MONURON D6 manufacturers
- Monuron-D6
-
-
2026-05-11
- CAS:217488-65-8
- Purity:
- Supply Ability: 10g
|
| | MONURON D6 Basic information |
| Product Name: | MONURON D6 | | Synonyms: | [2H6]-Monuron;D6-Monuron;Monuron-(dimethyl-d6);Monuron D6 100 μg/mL in Acetone | | CAS: | 217488-65-8 | | MF: | C9H11ClN2O | | MW: | 198.65 | | EINECS: | | | Product Categories: | | | Mol File: | 217488-65-8.mol |  |
| | MONURON D6 Chemical Properties |
| Major Application | agriculture
environmental | | InChI | 1S/C9H11ClN2O/c1-12(2)9(13)11-8-5-3-7(10)4-6-8/h3-6H,1-2H3,(H,11,13)/i1D3,2D3 | | InChIKey | BMLIZLVNXIYGCK-WFGJKAKNSA-N | | SMILES | ClC1=CC=C(NC(N(C([2H])([2H])[2H])C([2H])([2H])[2H])=O)C=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Acute 1
Aquatic Chronic 1
Carc. 2 |
| | MONURON D6 Usage And Synthesis |
| Uses | agriculture
environmental |
| | MONURON D6 Preparation Products And Raw materials |
|