|
|
| | Bis(6,6,7,7,8,8,8-heptafluoro-2,2-dimethyl-3,5-octanedionate)copper(II) Basic information |
| Product Name: | Bis(6,6,7,7,8,8,8-heptafluoro-2,2-dimethyl-3,5-octanedionate)copper(II) | | Synonyms: | Bis[1,1,2,2-tetrafluoro-6,6-dimethyl-1-(trifluoromethoxy)-3,5-heptanedionato-κO3,κO5]copper;Bis-(6,6,7,7,8,8,8-heptafluoro-2,2-dimethyloctanedionato)-copper;Cu(FOD)2, Copper(II) (6,6,7,7,8,8,8-heptafluoro-2,2-dimethyl-3,5-octanedionate);Copper bis(6,6,7,7,8,8,8-heptafluoro-2,2-diMethyl-3,5-octane;1,1,2,2-Tetrafluoro-6,6-dimethyl-1-(trifluoromethoxy)-3,5-heptanedione copper complex;Copper,bis[1,1,2,2-tetrafluoro-6,6-dimethyl-1-(trifluoromethoxy)-3,5-heptanedionato-O3,O5]-(9CI);Bis 6,6,7,7,8,8,8-heptafluoro-2,2-dimethyl-3,5-octanedionate)copper (II) [Cu(FOD)2];Copperheptafluorodimethyloctanedionate | | CAS: | 80289-21-0 | | MF: | C20H20CuF14O4 | | MW: | 653.8940448 | | EINECS: | | | Product Categories: | Cu;OTf&NTf series;metal fluorobeta-diketonate complexes | | Mol File: | 80289-21-0.mol |  |
| | Bis(6,6,7,7,8,8,8-heptafluoro-2,2-dimethyl-3,5-octanedionate)copper(II) Chemical Properties |
| Melting point | 59-61 °C(lit.) | | Boiling point | 280°C | | form | Powder | | color | blue to purple | | Sensitive | moisture sensitive | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | InChI | 1S/2C10H11F7O2.Cu/c2*1-7(2,3)5(18)4-6(19)8(11,12)9(13,14)10(15,16)17;/h2*4,19H,1-3H3;/q;;+2/p-2/b2*6-4-; | | InChIKey | OXBBKSQDOOZZFZ-IHJILFKMSA-L | | SMILES | CC(C)(C)C(=O)\C=C(/O[Cu]O\C(=C/C(=O)C(C)(C)C)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F | | EPA Substance Registry System | Copper(2+) bis(6,6,7,7,8,8,8-heptafluoro-2,2-dimethyl-5-oxooct-3-en-3-olate) (80289-21-0) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | Hazard Note | Irritant | | TSCA | No | | HS Code | 2914790090 | | Storage Class | 11 - Combustible Solids |
| | Bis(6,6,7,7,8,8,8-heptafluoro-2,2-dimethyl-3,5-octanedionate)copper(II) Usage And Synthesis |
| General Description | Atomic number of base material: 29 Copper | | reaction suitability | core: copper |
| | Bis(6,6,7,7,8,8,8-heptafluoro-2,2-dimethyl-3,5-octanedionate)copper(II) Preparation Products And Raw materials |
|