|
|
| | 2-[(Acetyloxy)methoxy]ethyl acetate Basic information |
| | 2-[(Acetyloxy)methoxy]ethyl acetate Chemical Properties |
| Boiling point | 114-1180C/4Torr | | density | 1.1382 g/cm3 | | refractive index | 1.4210 to 1.4250 | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | form | clear liquid | | color | Colorless to Almost colorless | | Stability: | Below 40C | | InChI | InChI=1S/C7H12O5/c1-6(8)11-4-3-10-5-12-7(2)9/h3-5H2,1-2H3 | | InChIKey | XFEQOLXBMLXKDE-UHFFFAOYSA-N | | SMILES | C(OC(=O)C)COCOC(C)=O | | CAS DataBase Reference | 59278-00-1(CAS DataBase Reference) |
| | 2-[(Acetyloxy)methoxy]ethyl acetate Usage And Synthesis |
| Chemical Properties | Bright Yellow Liquid | | Uses | Intermediate for the preparation of Acyclovir-d4. |
| | 2-[(Acetyloxy)methoxy]ethyl acetate Preparation Products And Raw materials |
|