|
|
| | L-Alaninamide Basic information |
| Product Name: | L-Alaninamide | | Synonyms: | N-ACETYL-L-ALANINE AMIDE;(S)-2-Amino-propionamide;L-Alaninamide;(2S)-2-Aminopropionamide;Alaninamide;Propanamide, 2-amino-,(2S)-;L-Alanimide;(S)-2-Aminopropanamide | | CAS: | 7324-05-2 | | MF: | C3H8N2O | | MW: | 88.11 | | EINECS: | | | Product Categories: | | | Mol File: | 7324-05-2.mol |  |
| | L-Alaninamide Chemical Properties |
| Melting point | 74-76 °C | | Boiling point | 247.4±23.0 °C(Predicted) | | density | 1.062±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 15.99±0.50(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C3H8N2O/c1-2(4)3(5)6/h2H,4H2,1H3,(H2,5,6)/t2-/m0/s1 | | InChIKey | HQMLIDZJXVVKCW-REOHCLBHSA-N | | SMILES | C(N)(=O)[C@@H](N)C |
| | L-Alaninamide Usage And Synthesis |
| Definition | ChEBI: L-alaninamide is an amino acid amide that is L-alanine in which the carboxy OH group is replaced by NH2. It is an amino acid amide and a L-alanine derivative. It is a conjugate base of a L-alaninamide(1+). |
| | L-Alaninamide Preparation Products And Raw materials |
|