| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
| Company Name: |
TargetMol |
| Tel: |
400-821-0310 15002144251 |
| Email: |
xuexiang.shao@tsbiochem.com |
|
| | CIL-102 Basic information |
| Product Name: | CIL-102 | | Synonyms: | Ethanone, 1-[4-(furo[2,3-b]quinolin-4-ylamino)phenyl]- | | CAS: | 479077-76-4 | | MF: | C19H14N2O2 | | MW: | 302.33 | | EINECS: | | | Product Categories: | | | Mol File: | 479077-76-4.mol |  |
| | CIL-102 Chemical Properties |
| storage temp. | −20°C | | solubility | DMSO: 12 mg/mL | | form | solid | | InChI | 1S/C19H14N2O2/c1-12(22)13-6-8-14(9-7-13)20-18-15-4-2-3-5-17(15)21-19-16(18)10-11-23-19/h2-11H,1H3,(H,20,21) | | InChIKey | VJDPGTFIMDGXDQ-UHFFFAOYSA-N | | SMILES | CC(=O)c1ccc(Nc2c3ccccc3nc4occc24)cc1 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | CIL-102 Usage And Synthesis |
| Uses | CIL-102 is an inhibitor of Tubulin polymerization. | | Biological Activity | CIL-102 is a tubulin polymerization inhibitor: apoptosis inducer. | | IC 50 | MMP-2; MMP-9 |
| | CIL-102 Preparation Products And Raw materials |
|