| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3-(4-Methoxybenzoyl)acrylic acid Basic information |
| | 3-(4-Methoxybenzoyl)acrylic acid Chemical Properties |
| Melting point | 132-136 °C(lit.) | | Boiling point | 389.3±42.0 °C(Predicted) | | density | 1.240±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 3.25±0.10(Predicted) | | form | solid | | Appearance | Off-white to yellow Solid | | BRN | 474529 | | InChI | 1S/C11H10O4/c1-15-9-4-2-8(3-5-9)10(12)6-7-11(13)14/h2-7H,1H3,(H,13,14)/b7-6+ | | InChIKey | WORYXBDHTBWLLL-VOTSOKGWSA-N | | SMILES | COc1ccc(cc1)C(=O)\C=C\C(O)=O | | CAS DataBase Reference | 5711-41-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | AT2250000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3-(4-Methoxybenzoyl)acrylic acid Usage And Synthesis |
| | 3-(4-Methoxybenzoyl)acrylic acid Preparation Products And Raw materials |
|