| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
5,6-Dehydroarachidonic acid manufacturers
|
| | 5,6-Dehydroarachidonic acid Basic information |
| Product Name: | 5,6-Dehydroarachidonic acid | | Synonyms: | 5,6-dehydro aa;eicosa-8,11,14-trien-5-ynoic acid;5,6-dehydro AA, cis-8,11,14-Eicosatrien-5-ynoic acid;CIS-8,11,14-EICOSATRIEN-5-YNOIC ACID;GIOQWSLKUVKKAO-QNEBEIHSSA-N;8Z,11Z,14Z-EICOSATRIEN-5-YNOIC ACID;8,11,14-Eicosatrien-5-ynoic acid, (8Z,11Z,14Z)-;5,6 dehydro Arachidonic Acid,5,6dehydro Arachidonic Acid | | CAS: | 58688-54-3 | | MF: | C20H30O2 | | MW: | 302.45 | | EINECS: | | | Product Categories: | | | Mol File: | 58688-54-3.mol |  |
| | 5,6-Dehydroarachidonic acid Chemical Properties |
| Boiling point | 444.707±45.00 °C(Press: 760.00 Torr)(predicted) | | density | 0.953±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | Fp | 17 °C | | storage temp. | −20°C | | solubility | 0.15 M Tris-HCl pH 8.5: >1 mg/ml (from Oleic Acid); DMF: >100 mg/ml (from Oleic Acid); DMSO: >100 mg/ml (from Oleic Acid); Ethanol: >100 mg/ml (from Oleic Acid); PBS pH 7.2: <100 μg/ml (from Oleic Acid) | | form | ethanol solution | | pka | 4.615±0.10(predicted) | | InChI | 1S/C20H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h6-7,9-10,12-13H,2-5,8,11,14,17-19H2,1H3,(H,21,22)/b7-6-,10-9-,13-12- | | InChIKey | GIOQWSLKUVKKAO-QNEBEIHSSA-N | | SMILES | CCCCC\C=C/C\C=C/C\C=C/CC#CCCCC(O)=O |
| Hazard Codes | F | | Risk Statements | 11-16 | | Safety Statements | 16-7 | | RIDADR | UN 1170 3/PG 2 | | WGK Germany | 1 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2
Flam. Liq. 2 |
| | 5,6-Dehydroarachidonic acid Usage And Synthesis |
| Uses | 5,6-Dehydroarachidonic acid is a 5-lipoxygenase (Lipoxygenase) inhibitor that inhibits the biosynthesis of leukotrienes. However, 5,6-Dehydroarachidonic acid had no effect on vascular cell proliferation[1][2][3]. | | Definition | ChEBI: 5,6-dehydro Arachidonic Acid is a long-chain fatty acid. | | Biological Activity | Inhibits 5-lipoxygenase of guinea pig leukocytes with an IC50 of 10 μM. In extracts of r at basophilic leukemia cells preincubated with 5,6-dehydro AA, the Ki for the conversion of arachidonic acid to 5-HPETE is 15 μM. | | References | [1] Sok DE, et al. Inhibition of leukotriene biosynthesis by acetylenic analogs. Biochem Biophys Res Commun. 1982 Jul 16;107(1):101-8. DOI:10.1016/0006-291x(82)91675-8
[2] Dethlefsen SM, et al. Arachidonic acid metabolites in bFGF-, PDGF-, and serum-stimulated vascular cell growth. Exp Cell Res. 1994 Jun;212(2):262-73. DOI:10.1006/excr.1994.1142
[3] Corey E J, et al. Synthesis of three potential inhibitors of the biosynthesis of leukotrienes A–E[J]. Tetrahedron Letters, 1980, 21(44): 4243-4246. |
| | 5,6-Dehydroarachidonic acid Preparation Products And Raw materials |
|