|
|
| | H-MET-ALA-SER-OH Basic information |
| | H-MET-ALA-SER-OH Chemical Properties |
| storage temp. | -20°C | | form | powder | | color | white | | InChI | 1S/C11H21N3O5S/c1-6(9(16)14-8(5-15)11(18)19)13-10(17)7(12)3-4-20-2/h6-8,15H,3-5,12H2,1-2H3,(H,13,17)(H,14,16)(H,18,19)/t6-,7-,8-/m0/s1 | | InChIKey | WXHHTBVYQOSYSL-FXQIFTODSA-N | | SMILES | CSCC[C@H](N)C(=O)N[C@@H](C)C(=O)N[C@@H](CO)C(O)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | H-MET-ALA-SER-OH Usage And Synthesis |
| Uses | Met-Ala-Ser has been used as a tripeptide in the OH radical-induced oxidation reaction and analysis by high performance liquid chromatography-diode array detector-fluorescence detector (HPLC-DAD-FLD). | | Definition | ChEBI: Met-Ala-Ser is an oligopeptide. | | Biochem/physiol Actions | Met-Ala-Ser (MAS) is used to complex with peptide deformylase(s) (PDF) to help delineate mechanisms of recognition of mimic-peptides by N-terminal cleaved expression peptide. |
| | H-MET-ALA-SER-OH Preparation Products And Raw materials |
|