Trityl methacrylate manufacturers
- Trityl methacrylate
-
-
2026-07-27
- CAS:19302-93-3
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1000kg
|
| | Trityl methacrylate Basic information |
| Product Name: | Trityl methacrylate | | Synonyms: | Methacrylic acid triphenylmethyl ester;Methacrylic acid α,α-diphenylbenzyl ester;Triphenylmethyl methacrylate;TRITYL METHACRYLATE;Triphenylmethyl 2-methyl-2- propenoate;2-Propenoic acid, 2-methyl-, triphenylmethyl ester | | CAS: | 19302-93-3 | | MF: | C23H20O2 | | MW: | 328.4 | | EINECS: | | | Product Categories: | monomer | | Mol File: | 19302-93-3.mol |  |
| | Trityl methacrylate Chemical Properties |
| Melting point | 101-103 °C(Solv: ethyl ether (60-29-7)) | | Boiling point | 436.8±14.0 °C(Predicted) | | density | 1.105±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C23H20O2/c1-18(2)22(24)25-23(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21/h3-17H,1H2,2H3 | | InChIKey | PTVDYMGQGCNETM-UHFFFAOYSA-N | | SMILES | C(OC(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1)(=O)C(C)=C |
| | Trityl methacrylate Usage And Synthesis |
| Uses | Trityl methacrylate is an organic synthesis or reaction reagent used in the preparation of a wide range of polymers or other compounds. | | Synthesis |
Trityl methacrylate could be synthesized by reacting Trimethyl Methacryloxysilane with Triphenylmethyl fluoride.
|
| | Trityl methacrylate Preparation Products And Raw materials |
|