| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:AroMadendrene oxide 2
CAS:85710-39-0
Purity:>=95.0% Package:100MG
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Aromadendrene oxide 2
CAS:85710-39-0
Purity:>=95.0% Package:100MG Remarks:11070-100MG
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:Aromadendrene oxide 2
CAS:85710-39-0
|
| Company Name: |
Santa Cruz Biotechnology Inc
|
| Tel: |
021-60936350 |
| Email: |
scbt@scbt.com |
| Products Intro: |
Product Name:Aromadendrene oxide 2
CAS:85710-39-0
|
|
| | AROMADENDRENE OXIDE 2 Basic information |
| Product Name: | AROMADENDRENE OXIDE 2 | | Synonyms: | AROMADENDRENE OXIDE 2;(1aR,4S,4aβ,7aα,7bβ)-Decahydro-1,1,7β-trimethylspiro[4H-cycloprop[e]azulene-4,2'-oxirane];Spiro[4H-cycloprop[e]azulene-4,2'-oxirane], decahydro-1,1,7-trimethyl-, (1aR,2'S,4aR,7R,7aS,7bS)-;Aromadendrene epoxide | | CAS: | 85710-39-0 | | MF: | C15H24O | | MW: | 220.35 | | EINECS: | | | Product Categories: | Epoxides;Organic Building Blocks;Oxygen Compounds | | Mol File: | 85710-39-0.mol |  |
| | AROMADENDRENE OXIDE 2 Chemical Properties |
| Boiling point | 274.7±8.0 °C(Predicted) | | density | 1.04±0.1 g/cm3(Predicted) | | InChI | 1S/C15H24O/c1-9-4-5-10-12(9)13-11(14(13,2)3)6-7-15(10)8-16-15/h9-13H,4-8H2,1-3H3/t9-,10-,11-,12-,13-,15-/m1/s1 | | InChIKey | XPGWKKLDFXNBPJ-QTPLKFIXSA-N | | SMILES | C[C@@H]1CC[C@@H]2[C@@H]1[C@H]3[C@@H](CC[C@@]24CO4)C3(C)C | | LogP | 4.201 (est) |
| Safety Statements | 23-24/25 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | AROMADENDRENE OXIDE 2 Usage And Synthesis |
| Biochem/physiol Actions | Aromadendrene oxide 2 is one of the biologically active component of Lantana camara that shows antimicrobial property. |
| | AROMADENDRENE OXIDE 2 Preparation Products And Raw materials |
|