| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
| Products Intro: |
Product Name:6-(2,2-Dicyanovinyl)-N-(2-hydroxyethyl)-1,2,3,4-tetrahydroquinoline CAS:142978-25-4 Purity:NULL Package:5mg Remarks:NULL
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:6-(2,2-Dicyanovinyl)-N-(2-hydroxyethyl)-1,2,3,4-tetrahydroquinoline CAS:142978-25-4
|
| Company Name: |
Santa Cruz Biotechnology Inc
|
| Tel: |
021-60936350 |
| Email: |
scbt@scbt.com |
| Products Intro: |
Product Name:6-(2,2-Dicyanovinyl)-N-(2-hydroxyethyl)-1,2,3,4-tetrahydroquinoline CAS:142978-25-4
|
| Company Name: |
Riedel-de Haen AG
|
| Tel: |
800 558-9160 |
| Email: |
|
| Products Intro: |
Product Name:6-(2,2-Dicyanovinyl)-N-(2-hydroxyethyl)-1,2,3,4-tetrahydroquinoline CAS:142978-25-4
|
|
| | 6-(2,2-DICYANOVINYL)-N-(2-HYDROXYETHYL)-1,2,3,4-TETRAHYDROQUINOLINE Basic information |
| Product Name: | 6-(2,2-DICYANOVINYL)-N-(2-HYDROXYETHYL)-1,2,3,4-TETRAHYDROQUINOLINE | | Synonyms: | 6-(2,2-DICYANOVINYL)-N-(2-HYDROXYETHYL)-1,2,3,4-TETRAHYDROQUINOLINE;6-(2,2-dicyanovinyl)-N-(2-*hydroxyethyl)-1,2,3,4-;1-(2-hydroxyethyl)-6-((2,2-dicyano)vinyl)-2,3,4-trihydroquinoline;6-[(2,2-Dicyano)-vinyl]-1-(2-hydroxyethyl)-2,3,4-trihydroquinoline;6-(2,2-dicyanovinyl)-N-(2-hydroxyethyl)tetrahydroquinoline;Propanedinitrile, 2-[[1,2,3,4-tetrahydro-1-(2-hydroxyethyl)-6-quinolinyl]methylene]- | | CAS: | 142978-25-4 | | MF: | C15H15N3O | | MW: | 253.3 | | EINECS: | | | Product Categories: | D;Stains and Dyes;Stains&Dyes, A to | | Mol File: | 142978-25-4.mol |  |
| | 6-(2,2-DICYANOVINYL)-N-(2-HYDROXYETHYL)-1,2,3,4-TETRAHYDROQUINOLINE Chemical Properties |
| Boiling point | 516.9±50.0 °C(Predicted) | | density | 1.226±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | acetonitrile: 20mg/mL | | form | powder | | pka | 14.34±0.10(Predicted) | | color | orange | | Major Application | diagnostic assay manufacturing hematology histology | | InChI | 1S/C15H17N3O/c16-10-13(11-17)8-12-3-4-15-14(9-12)2-1-5-18(15)6-7-19/h3-4,9,13,19H,1-2,5-8H2 | | InChIKey | ANBPREOOKGEEDY-UHFFFAOYSA-N | | SMILES | OCCN1CCCc2cc(CC(C#N)C#N)ccc12 | | EPA Substance Registry System | Propanedinitrile, [[1,2,3,4-tetrahydro-1-(2-hydroxyethyl)-6-quinolinyl]methylene]- (142978-25-4) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 6-(2,2-DICYANOVINYL)-N-(2-HYDROXYETHYL)-1,2,3,4-TETRAHYDROQUINOLINE Usage And Synthesis |
| Uses | 6-?(2,?2-?Dicyanovinyl)?-?N-?(2-?hydroxyethyl)?-?1,?2,?3,?4-?tetrahydroquinoline is a fluorescent rotor molecule. Dyes and metabolites. |
| | 6-(2,2-DICYANOVINYL)-N-(2-HYDROXYETHYL)-1,2,3,4-TETRAHYDROQUINOLINE Preparation Products And Raw materials |
|