| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
4-(3-Bromo-phenyl)-piperazine-1-carboxylic acid tert-butyl ester manufacturers
|
| | 4-(3-Bromo-phenyl)-piperazine-1-carboxylic acid tert-butyl ester Basic information |
| Product Name: | 4-(3-Bromo-phenyl)-piperazine-1-carboxylic acid tert-butyl ester | | Synonyms: | t-Butyl 4-(3-Bromophenyl)piperazine-1-carboxylate;tert-Butyl 4-(3-bromophenyl)piperazine-1-carboxylate, 4-(3-Bromophenyl)-1-(tert-butoxycarbonyl)piperazine, 1-Bromo-3-[4-(tert-butoxycarbonyl)piperazin-1-yl]benzene;1-BOC-4-(3-Bromophenyl)piperazine;1-Piperazinecarboxylic acid, 4-(3-bromophenyl)-, 1,1-dimethylethyl ester;tert-Butyl 4-(3-broMophenyl)piperazine-1-carboxylate;4-(3-Bromo-phenyl)-piperazine-1-carboxylic acid tert-butyl ester | | CAS: | 327030-39-7 | | MF: | C15H21BrN2O2 | | MW: | 341.24 | | EINECS: | | | Product Categories: | Aryl;Organohalides | | Mol File: | 327030-39-7.mol |  |
| | 4-(3-Bromo-phenyl)-piperazine-1-carboxylic acid tert-butyl ester Chemical Properties |
| Boiling point | 424.6±40.0 °C(Predicted) | | density | 1.332±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 2.12±0.20(Predicted) | | Appearance | White to light yellow Solid | | InChI | InChI=1S/C15H21BrN2O2/c1-15(2,3)20-14(19)18-9-7-17(8-10-18)13-6-4-5-12(16)11-13/h4-6,11H,7-10H2,1-3H3 | | InChIKey | DVJZPRQEOHFPQO-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCN(C2=CC=CC(Br)=C2)CC1 |
| Hazard Codes | Xi | | HS Code | 2933599590 |
| | 4-(3-Bromo-phenyl)-piperazine-1-carboxylic acid tert-butyl ester Usage And Synthesis |
| | 4-(3-Bromo-phenyl)-piperazine-1-carboxylic acid tert-butyl ester Preparation Products And Raw materials |
|