|
|
| | 2,5,7-trimethyl-1H-quinolin-4-one Basic information |
| Product Name: | 2,5,7-trimethyl-1H-quinolin-4-one | | Synonyms: | OTAVA-BB BB7018670038;AKOS BBS-00009385;OTAVA-BB 7018670038;4-Hydroxy-2,5,7-trimethylquinoline;2,5,7-trimethylquinolin-4-ol;2,5,7-TRIMETHYL-4-QUINOLINOL;4-Quinolinol, 2,5,7-trimethyl-;2,5,7-trimethyl-1H-quinolin-4-one | | CAS: | 65674-07-9 | | MF: | C12H13NO | | MW: | 187.24 | | EINECS: | | | Product Categories: | | | Mol File: | 65674-07-9.mol |  |
| | 2,5,7-trimethyl-1H-quinolin-4-one Chemical Properties |
| Melting point | 288 °C (decomp) | | Boiling point | 344.4±37.0 °C(Predicted) | | density | 1.141±0.06 g/cm3(Predicted) | | pka | 4.67±0.40(Predicted) | | form | solid | | InChI | 1S/C12H13NO/c1-7-4-8(2)12-10(5-7)13-9(3)6-11(12)14/h4-6H,1-3H3,(H,13,14) | | InChIKey | RLAFUJHEIQCSIU-UHFFFAOYSA-N | | SMILES | OC1=C(C(C)=CC(C)=C2)C2=NC(C)=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2,5,7-trimethyl-1H-quinolin-4-one Usage And Synthesis |
| | 2,5,7-trimethyl-1H-quinolin-4-one Preparation Products And Raw materials |
|