| Company Name: |
skychemical Co.Ltd |
| Tel: |
021-20960837,QQ1332204249 |
| Email: |
sales@skychemical.com |
4-Mercaptoacetophenone manufacturers
|
| | 4-Mercaptoacetophenone Basic information |
| Product Name: | 4-Mercaptoacetophenone | | Synonyms: | 4-Acetylbenzenethiol;4-Acetylthiophenol;3-Chloro-6-dimethylaminopyridazine;1-(4-sulfanylphenyl)ethan-1-one;Ethanone, 1-(4-mercaptophenyl)-;1-(4-Thiophenyl)ethyl-1-one;RMA03288 RS;1-(4-sulfanylbenzyl) eth-1-ol | | CAS: | 3814-20-8 | | MF: | C8H8OS | | MW: | 152.21 | | EINECS: | | | Product Categories: | | | Mol File: | 3814-20-8.mol |  |
| | 4-Mercaptoacetophenone Chemical Properties |
| Melting point | 27-28.5 °C | | Boiling point | 142 °C | | density | 1.139±0.06 g/cm3(Predicted) | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 5.37±0.10(Predicted) | | form | Low-Melting Solid | | color | Yellow | | InChI | InChI=1S/C8H8OS/c1-6(9)7-2-4-8(10)5-3-7/h2-5,10H,1H3 | | InChIKey | QNGBRPMOFJSFMF-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC=C(S)C=C1)C |
| | 4-Mercaptoacetophenone Usage And Synthesis |
| Synthesis Reference(s) | Journal of the American Chemical Society, 75, p. 4657, 1953 DOI: 10.1021/ja01115a010 |
| | 4-Mercaptoacetophenone Preparation Products And Raw materials |
|