| Company Name: |
Quality Control Solutions Ltd.
|
| Tel: |
0755-66853366 13670046396 |
| Email: |
orders@qcsrm.com |
| Products Intro: |
Product Name:Hexachlorobenzene-13C6
CAS:93952-14-8
Purity:95% HPLC Package:10mg;25mg;50mg;100mg
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Hexachlorobenzene-13C6
CAS:93952-14-8
Purity:99 atom % 13C Package:10MG Remarks:606332-10MG
|
| Company Name: |
Alta Scientific Co., Ltd.
|
| Tel: |
022-6537-8550 15522853686 |
| Email: |
sales@altasci.com.cn |
| Products Intro: |
Product Name:Hexachlorobenzene-13C6
CAS:93952-14-8
Purity:99% Package:10mg;100mg;1g
|
|
| | HEXACHLOROBENZENE 13C6 Basic information |
| | HEXACHLOROBENZENE 13C6 Chemical Properties |
| storage temp. | 0-6°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Solid | | color | White to Off-White | | InChI | 1S/C6Cl6/c7-1-2(8)4(10)6(12)5(11)3(1)9/i1+1,2+1,3+1,4+1,5+1,6+1 | | InChIKey | CKAPSXZOOQJIBF-IDEBNGHGSA-N | | SMILES | Cl[13c]1[13c](Cl)[13c](Cl)[13c](Cl)[13c](Cl)[13c]1Cl | | EPA Substance Registry System | Hexachlorobenzene-13C6 (93952-14-8) | | CAS Number Unlabeled | 118-74-1 |
| Hazard Codes | T,N | | Risk Statements | 45-48/25-50/53 | | Safety Statements | 53-45-60-61 | | RIDADR | UN 2729 6.1/PG 3 | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1
Carc. 1B
STOT RE 1 |
| | HEXACHLOROBENZENE 13C6 Usage And Synthesis |
| Uses | Hexachlorobenzene-13C6 , is the labeled analogue of Hexachlorobenzene, which is a fungicide formerly used as a seed treatment, especially on wheat to control the fungal disease bunt. |
| | HEXACHLOROBENZENE 13C6 Preparation Products And Raw materials |
|