|
|
| | 4,4-difluoroheptanedioic acid diethyl ester Basic information |
| Product Name: | 4,4-difluoroheptanedioic acid diethyl ester | | Synonyms: | DIETHYL 4,4-DIFLUOROHEPTANEDIONATE;Diethyl 4,4-difluoroheptanedio;4,4-DIFLUOROHEPTANEDIOIC ACID DIETHYL ESTER;DIETHYL 4,4-DIFLUOROHEPTANEDIOATE;Diethyl 4,4-difluoropimelate,;Diethyl 4,4-difluoroheptane-1,7-dioate 96%;1,7-diethyl 4,4-difluoroheptanedioate;4,4-Difluoro heptanoic acid diethyl ester | | CAS: | 22515-16-8 | | MF: | C11H18F2O4 | | MW: | 252.26 | | EINECS: | | | Product Categories: | | | Mol File: | 22515-16-8.mol |  |
| | 4,4-difluoroheptanedioic acid diethyl ester Chemical Properties |
| Boiling point | 108°C/3mm | | density | 1.106±0.06 g/cm3(Predicted) | | refractive index | 1.4150 | | Fp | 105℃ | | storage temp. | Sealed in dry,Room Temperature | | form | liquid | | color | Clear, colourless | | InChI | InChI=1S/C11H18F2O4/c1-3-16-9(14)5-7-11(12,13)8-6-10(15)17-4-2/h3-8H2,1-2H3 | | InChIKey | XUOBBVMKXUPPEW-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)CCC(F)(F)CCC(OCC)=O |
| Hazard Codes | Xi | | Safety Statements | 24/25 | | HazardClass | IRRITANT | | HS Code | 29171900 |
| | 4,4-difluoroheptanedioic acid diethyl ester Usage And Synthesis |
| | 4,4-difluoroheptanedioic acid diethyl ester Preparation Products And Raw materials |
|