|
|
| | 1,3-Dithiane-2-carboxylic acid Basic information |
| Product Name: | 1,3-Dithiane-2-carboxylic acid | | Synonyms: | Glyoxylic Acid Trimethylene Dithioacetal;1,3-Dithiane-2-carboxylic acid - [D94480];1,3-dithioalkane-2-macetic acid;1,3-Dithiane-2-carboxylic acid | | CAS: | 20461-89-6 | | MF: | C5H8O2S2 | | MW: | 164.25 | | EINECS: | | | Product Categories: | | | Mol File: | 20461-89-6.mol |  |
| | 1,3-Dithiane-2-carboxylic acid Chemical Properties |
| Melting point | 115-116 °C | | Boiling point | 354.7±42.0 °C(Predicted) | | density | 1.395±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. -20°C | | pka | 2.79±0.20(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C5H8O2S2/c6-4(7)5-8-2-1-3-9-5/h5H,1-3H2,(H,6,7) | | InChIKey | BZBYEAWKJNCPLB-UHFFFAOYSA-N | | SMILES | S1CCCSC1C(O)=O |
| | 1,3-Dithiane-2-carboxylic acid Usage And Synthesis |
| | 1,3-Dithiane-2-carboxylic acid Preparation Products And Raw materials |
|