| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2,6-Dinitrobenzaldehyde Basic information |
| | 2,6-Dinitrobenzaldehyde Chemical Properties |
| Melting point | 120-122 °C (lit.) | | Boiling point | 363.2±32.0 °C(Predicted) | | density | 1.571±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | BRN | 2113951 | | InChI | 1S/C7H4N2O5/c10-4-5-6(8(11)12)2-1-3-7(5)9(13)14/h1-4H | | InChIKey | WHFZQNNDIJKLIO-UHFFFAOYSA-N | | SMILES | [H]C(=O)c1c(cccc1[N+]([O-])=O)[N+]([O-])=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | CU5957500 | | F | 9 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2,6-Dinitrobenzaldehyde Usage And Synthesis |
| Uses | 2,6-Dinitrobenzaldehyde was used in the synthesis of free base tetrakis(2,6-dinitrophenyl) porphyrin. | | General Description | 2,6-Dinitrobenzaldehyde is the major intermediate formed by the combined ozonation of 2,6-dinitrotoluene with hydrogen peroxide and UV radiation. |
| | 2,6-Dinitrobenzaldehyde Preparation Products And Raw materials |
|