| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
|
| | 1,2-Bis(di-tert-butylphosphinomethyl)benzene Basic information |
| Product Name: | 1,2-Bis(di-tert-butylphosphinomethyl)benzene | | Synonyms: | alpha:,alpha:'-Bis(di-t-butylphosphino)-o-xylene, min. 97%;α,α'-bis(di-t-butylphosphino)-o-xylene;a,a'-Bis(di-t-butylphosphino)-o-xylene, min. 97%;1,2-Bis(di-t-butylphosphinoMethyl)benzene, 98%;1,2-Bis(di-t-butylphosphinoMethyl)benzene, 97+%;α,α'-Bis(di-t-butylphosphino)-o-xylene, min. 97%;α,α'-Bis(di-t-butylphosphino)-o-xylene,96%;ALPHA, ALPHA'-BIS(DI-T-BUTYLPHOSPHINO)-O-XYLENE | | CAS: | 121954-50-5 | | MF: | C24H44P2 | | MW: | 394.55 | | EINECS: | | | Product Categories: | Achiral Phosphine;Aryl Phosphine;Catalysis and Inorganic Chemistry;Phosphorus Compounds;Polydentate Phosphine Ligands | | Mol File: | 121954-50-5.mol |  |
| | 1,2-Bis(di-tert-butylphosphinomethyl)benzene Chemical Properties |
| Melting point | 59-62°C | | Boiling point | 456.7±38.0 °C(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | crystal | | color | white | | Sensitive | air sensitive | | InChI | InChI=1S/C24H44P2/c1-21(2,3)25(22(4,5)6)17-19-15-13-14-16-20(19)18-26(23(7,8)9)24(10,11)12/h13-16H,17-18H2,1-12H3 | | InChIKey | SFCNPIUDAIFHRD-UHFFFAOYSA-N | | SMILES | C1C=C(CP(C(C)(C)C)C(C)(C)C)C(CP(C(C)(C)C)C(C)(C)C)=CC=1 |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 1,2-Bis(di-tert-butylphosphinomethyl)benzene Usage And Synthesis |
| Uses | DTBPMB may be used as a ligand for the palladium-catalyzed hydroesterification of styrene and vinyl acetate to form branched esters in the presence of polymeric sulfonic acids promoters. | | General Description | 1,2-Bis(di-tert-butylphosphinomethyl)benzene (DTBPMB) is a bidentate phosphine ligand. DTBPMB in combination with Pd2(dba)3 (dba = trans,trans-dibenzylideneacetone) and a sulfonic acid can catalyze the methoxycarbonylation of ethane to form methyl propanoate. | | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: ligand |
| | 1,2-Bis(di-tert-butylphosphinomethyl)benzene Preparation Products And Raw materials |
|