| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 1-Methylbenzimidazole Basic information |
| | 1-Methylbenzimidazole Chemical Properties |
| Melting point | 59-62 °C(lit.) | | Boiling point | 154 °C12 mm Hg(lit.) | | density | 1.1254 | | refractive index | 1.6013 | | Fp | 154°C/12mm | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Soluble in methanol. | | form | Solid | | pka | 5.40±0.10(Predicted) | | color | White to pink | | λmax | 277nm(H2O)(lit.) | | InChI | InChI=1S/C8H8N2/c1-10-6-9-7-4-2-3-5-8(7)10/h2-6H,1H3 | | InChIKey | FGYADSCZTQOAFK-UHFFFAOYSA-N | | SMILES | C1N(C)C2=CC=CC=C2N=1 | | CAS DataBase Reference | 1632-83-3(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22-37/38-41 | | Safety Statements | 26-36/39 | | WGK Germany | 3 | | HS Code | 29339980 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1
Skin Irrit. 2
STOT SE 3 |
| | 1-Methylbenzimidazole Usage And Synthesis |
| Uses | 1-Methylbenzimidazole is the suitable reagent used as electrolyte additive for the dye-sensitized solar cells and solid-state dye-sensitized solar cells. | | General Description | 1-Methylbenzimidazole is a heterocyclic building block. Effect of the interaction between 1-methylbenzimidazole (MBI) with Li+ and TiO2 on the performance of dye-sensitized solar cells has been investigated. |
| | 1-Methylbenzimidazole Preparation Products And Raw materials |
|