|
|
| | L-Ornithine HCl (3,3,4,4,5,5-d6) Basic information |
| Product Name: | L-Ornithine HCl (3,3,4,4,5,5-d6) | | Synonyms: | L-ORNITHINE-3,3,4,4,5,5-D6 HCL;L-ORNITHINE-3,3,4,4,5,5-D6 HYDROCHLORIDE;L-Ornithine-d6 Hydrochloride;L-Ornithine-d6 HCl;(S)-(+)-2,5-Diaminopentanoic acid-3,3,4,4,5,5-d6 hydrochloride;[2H6]- L-Ornithine Hydrochloride;L-Ornithine:HCL-d6;L-Aspartic acid-[D6] hydrochloride | | CAS: | 347841-40-1 | | MF: | C5H6D6N2O2.ClH | | MW: | 174.66 | | EINECS: | | | Product Categories: | | | Mol File: | 347841-40-1.mol |  |
| | L-Ornithine HCl (3,3,4,4,5,5-d6) Chemical Properties |
| Melting point | 245 °C (dec)(lit.) | | storage temp. | Refrigerator | | solubility | Aqueous Acid (Slightly), Water (Slightly) | | form | Solid | | color | White to Off-White | | InChI | 1S/C5H12N2O2.ClH/c6-3-1-2-4(7)5(8)9;/h4H,1-3,6-7H2,(H,8,9);1H/t4-;/m0./s1/i1D2,2D2,3D2; | | InChIKey | GGTYBZJRPHEQDG-IYAGNYDCSA-N | | SMILES | Cl.[2H]C([2H])(N)C([2H])([2H])C([2H])([2H])[C@H](N)C(O)=O | | CAS Number Unlabeled | 3184-13-2 |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | 2 | | Storage Class | 11 - Combustible Solids |
| | L-Ornithine HCl (3,3,4,4,5,5-d6) Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Labelled L-Ornithine. A non-essential amino acid for human development but is required intermediate in arginine biosynthesis. L-Ornithine is found in virtually all vertebrate tissues as well as incorporated into proteins, such as tyrocidine. Isolation from chicken excreta. |
| | L-Ornithine HCl (3,3,4,4,5,5-d6) Preparation Products And Raw materials |
|