|
|
| | 4-BENZOOXAZOL-2-YL-PHENYLAMINE Basic information |
| Product Name: | 4-BENZOOXAZOL-2-YL-PHENYLAMINE | | Synonyms: | ASISCHEM T30955;CHEMBRDG-BB 4101678;LABOTEST-BB LT00133884;4-BENZOOXAZOL-2-YL-PHENYLAMINE;4-(1,3-BENZOXAZOL-2-YL)PHENYLAMINE;AKOS BB-8497;OTAVA-BB BB7216513381;TIMTEC-BB SBB000494 | | CAS: | 20934-81-0 | | MF: | C13H10N2O | | MW: | 210.23 | | EINECS: | 200-258-5 | | Product Categories: | | | Mol File: | 20934-81-0.mol |  |
| | 4-BENZOOXAZOL-2-YL-PHENYLAMINE Chemical Properties |
| Melting point | 169-170 °C | | Boiling point | 361.4±25.0 °C(Predicted) | | density | 1.257±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | DMSO : ≥ 100 mg/mL (475.67 mM) | | form | Solid | | pka | 3.29±0.10(Predicted) | | color | Light brown to brown | | InChI | InChI=1S/C13H10N2O/c14-10-7-5-9(6-8-10)13-15-11-3-1-2-4-12(11)16-13/h1-8H,14H2 | | InChIKey | XZYQBYQGHHGXBC-UHFFFAOYSA-N | | SMILES | C1(N)=CC=C(C2=NC3=CC=CC=C3O2)C=C1 | | EPA Substance Registry System | Benzenamine, 4-(2-benzoxazolyl)- (20934-81-0) |
| Hazard Codes | Xi | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 2934999090 |
| | 4-BENZOOXAZOL-2-YL-PHENYLAMINE Usage And Synthesis |
| Uses | 4-(Benzo[d]oxazol-2-yl)aniline is a potent antitumor agent. 4-(Benzo[d]oxazol-2-yl)aniline has inhibitory activity against mammary carcinoma cell lines[1]. | | Synthesis Reference(s) | Journal of Medicinal Chemistry, 39, p. 3375, 1996 DOI: 10.1021/jm9600959 | | References | [1] Shi DF, et al. Antitumor benzothiazoles. 3. Synthesis of 2-(4-aminophenyl)benzothiazoles and evaluation of their activities against breast cancer cell lines in vitro and in vivo. J Med Chem. 1996 Aug 16;39(17):3375-84. DOI:10.1021/jm9600959 |
| | 4-BENZOOXAZOL-2-YL-PHENYLAMINE Preparation Products And Raw materials |
|