|
|
| | 3-(1-Nitroethyl)-2-benzofuran-1(3H)-one Basic information |
| Product Name: | 3-(1-Nitroethyl)-2-benzofuran-1(3H)-one | | Synonyms: | 3-(1-nitroethyl)-3H-2-benzofuran-1-one;(3S)-3-[(1R)-1-nitroethyl]-3H-isobenzofuran-1-one;3-(1-Nitroethyl)isobenzofuran-1(3H)-one;1(3H)-Isobenzofuranone, 3-(1-nitroethyl)-;3-(1-Nitroethyl)-2-benzofuran-1(3H)-one;3-(1-Nitroethyl)-2-benzofuran-1(3H)-one | | CAS: | 79017-08-6 | | MF: | C10H9NO4 | | MW: | 207.18 | | EINECS: | | | Product Categories: | | | Mol File: | 79017-08-6.mol |  |
| | 3-(1-Nitroethyl)-2-benzofuran-1(3H)-one Chemical Properties |
| Melting point | 99-102°C | | Boiling point | 398.6±35.0 °C(Predicted) | | density | 1.341±0.06 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 6.10±0.20(Predicted) | | form | Solid | | color | Off-White to Beige | | Stability: | Hygroscopic | | InChI | 1S/C10H9NO4/c1-6(11(13)14)9-7-4-2-3-5-8(7)10(12)15-9/h2-6,9H,1H3 | | InChIKey | FCWYFQGGRBDNRW-UHFFFAOYSA-N | | SMILES | O=C(O1)C2=CC=CC=C2C1C(C)[N+]([O-])=O |
| WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | 3-(1-Nitroethyl)-2-benzofuran-1(3H)-one Usage And Synthesis |
| Uses | 3-(1-Nitroethyl)-2-benzofuran-1(3H)-one can be used as an antihypertensive. |
| | 3-(1-Nitroethyl)-2-benzofuran-1(3H)-one Preparation Products And Raw materials |
|