| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Manganese sulfate monohydrate Basic information |
| | Manganese sulfate monohydrate Chemical Properties |
| Melting point | 700 °C | | Boiling point | 850 °C | | storage temp. | 2-8°C | | solubility | Water (Slightly) | | form | Liquid | | color | Pink | | Water Solubility | Soluble in water. | | Sensitive | Hygroscopic | | Merck | 14,5739 | | Exposure limits | ACGIH: TWA 0.02 mg/m3; TWA 0.1 mg/m3
OSHA: Ceiling 5 mg/m3
NIOSH: IDLH 500 mg/m3; TWA 1 mg/m3; STEL 3 mg/m3 | | Major Application | battery precursors
catalysts
material synthesis precursor | | InChI | InChI=1S/Mn.H2O4S.H2O/c;1-5(2,3)4;/h;(H2,1,2,3,4);1H2/q+2;;/p-2 | | InChIKey | ISPYRSDWRDQNSW-UHFFFAOYSA-L | | SMILES | [Mn+2].S([O-])([O-])(=O)=O.[H]O[H] | | CAS DataBase Reference | 15244-36-7(CAS DataBase Reference) |
| Hazard Codes | Xn,N | | Risk Statements | 48/20/22-51/53 | | Safety Statements | 22-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 1 | | RTECS | OP0893500 | | F | 3 | | TSCA | Yes | | HazardClass | 9 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 2
STOT RE 2 |
| | Manganese sulfate monohydrate Usage And Synthesis |
| Uses | Used in feed additive, nutrient, firming agent and flavor enhancer. It is also used as a fermentation aid in the processing of beer and malt beverages. | | Definition | ChEBI: Manganese(II) sulfate monohydrate is a hydrate that is the monohydrate form of manganese(II) sulfate. It has a role as a nutraceutical. It is a hydrate, a manganese molecular entity and a metal sulfate. It contains a manganese(II) sulfate. | | Purification Methods | Crystallise it from water (0.9mL/g) at 54-55o by evaporating about two-thirds of the water. It dehydrates above 400o. |
| | Manganese sulfate monohydrate Preparation Products And Raw materials |
|