|
|
| | 4-Phenyl-2-butyl acetate Basic information |
| Product Name: | 4-Phenyl-2-butyl acetate | | Synonyms: | 2-Butanol, 4-phenyl-, acetate;alpha-methyl-benzenepropanoacetate;Benzenepropanol, alpha-methyl-, acetate;Benzenepropanol,.alpha.-methyl-,acetate;CH3C(O)OCH(CH3)CH2CH2C6H5;Phenylpropanol, alpha-methyl, acetate;1-METHYL-3-PHENYLPROPYL ACETATE;4-phenylbut-2-yl acetate | | CAS: | 10415-88-0 | | MF: | C12H16O2 | | MW: | 192.25 | | EINECS: | 233-890-6 | | Product Categories: | | | Mol File: | 10415-88-0.mol |  |
| | 4-Phenyl-2-butyl acetate Chemical Properties |
| Safety Statements | 24/25 | | TSCA | TSCA listed |
| Provider | Language |
|
ACROS
| English |
| | 4-Phenyl-2-butyl acetate Usage And Synthesis |
| Chemical Properties | 4-Phenyl-2-butyl acetate has a mild, green, fruity odor and a sweet, fruity taste. | | Preparation | By acetylation of the corresponding alcohol; the racemic and the dextrorotatory forms are known. | | Definition | ChEBI: 4-Phenyl-2-butyl acetate is a member of benzenes. |
| | 4-Phenyl-2-butyl acetate Preparation Products And Raw materials |
|