|
|
| | CARBOFURAN-3-HYDROXY Basic information |
| Product Name: | CARBOFURAN-3-HYDROXY | | Synonyms: | CARBOFURAN-3-HYDROXY;3-HYDROXYCARBOFURAN, 1 X 50MG, NEAT;CARBOFURAN-3-HYDROXY PESTANAL;3-Hydroxycarbofurane;3,7-Benzofurandiol, 2,3-dihydro-2,2-dimethyl-, 7-(methylcarbamate);3-Hydroxy-2,2-dimethyl-2,3-dihydro-1-benzofuran-7-yl methylcarbamate;7-benzofurandiol,2,3-dihydro-2,2-dimethyl-7-(methylcarbamate);Carbamic acid, methyl-, 2,3-dihydro-2,2-dimethyl-3-hydroxy-7-benzofuranyl ester | | CAS: | 16655-82-6 | | MF: | C12H15NO4 | | MW: | 237.25 | | EINECS: | | | Product Categories: | Alpha sort;C;CA - CGPesticides;CAlphabetic;CarbamatesEnvironmental Standards;Insecticides;Metabolites;Pesticides&Metabolites | | Mol File: | 16655-82-6.mol |  |
| | CARBOFURAN-3-HYDROXY Chemical Properties |
| Melting point | 140-148 °C | | Boiling point | 344.7±42.0 °C(Predicted) | | density | 1.239±0.06 g/cm3 (20 ºC 760 Torr) | | Fp | -4 °C | | storage temp. | -20°C | | solubility | Chloroform: Soluble; Methanol: Soluble | | pka | 12.28±0.46(Predicted) | | BRN | 1383873 | | Major Application | agriculture environmental | | InChI | InChI=1S/C12H15NO4/c1-12(2)10(14)7-5-4-6-8(9(7)17-12)16-11(15)13-3/h4-6,10,14H,1-3H3,(H,13,15) | | InChIKey | RHSUJRQZTQNSLL-UHFFFAOYSA-N | | SMILES | O1C2=C(OC(=O)NC)C=CC=C2C(O)C1(C)C | | EPA Substance Registry System | 3-Hydroxycarbofuran (16655-82-6) |
| Hazard Codes | T+,Xi,F | | Risk Statements | 28-67-66-36-11 | | Safety Statements | 28-36/37/39-45-33-26-16 | | RIDADR | 2757 | | WGK Germany | 3 | | RTECS | FB9500000 | | HazardClass | 6.1(a) | | PackingGroup | II | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | | Hazard Classifications | Acute Tox. 2 Oral | | Toxicity | mouse,LD50,oral,7mg/kg (7mg/kg),Pesticide Biochemistry and Physiology. Vol. 3, Pg. 435, 1973. |
| | CARBOFURAN-3-HYDROXY Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | 3-Hydroxy Carbofuran is a metabolite of Carbofuran (C176590). | | Definition | ChEBI: 3-Hydroxy-carbofuran is a member of 1-benzofurans. | | General Description | Carbofuran-3-hydroxy is one of the metabolites of the insecticide, carbofuran. |
| | CARBOFURAN-3-HYDROXY Preparation Products And Raw materials |
|